4-[2-(2-Methoxy-5-prop-1-enylphenyl)prop-2-enyl]phenol
| Internal ID | 7ac96e1a-f648-499b-bed2-93441de63a77 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 4-[2-(2-methoxy-5-prop-1-enylphenyl)prop-2-enyl]phenol |
| SMILES (Canonical) | CC=CC1=CC(=C(C=C1)OC)C(=C)CC2=CC=C(C=C2)O |
| SMILES (Isomeric) | CC=CC1=CC(=C(C=C1)OC)C(=C)CC2=CC=C(C=C2)O |
| InChI | InChI=1S/C19H20O2/c1-4-5-15-8-11-19(21-3)18(13-15)14(2)12-16-6-9-17(20)10-7-16/h4-11,13,20H,2,12H2,1,3H3 |
| InChI Key | RKXBXYXVNGUVCT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.146329876 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 5.50 |
| There are no found synonyms. |
![2D Structure of 4-[2-(2-Methoxy-5-prop-1-enylphenyl)prop-2-enyl]phenol](https://plantaedb.com/storage/docs/compounds/2023/11/4-2-2-methoxy-5-prop-1-enylphenylprop-2-enylphenol.jpg "2D Structure of 4-[2-(2-Methoxy-5-prop-1-enylphenyl)prop-2-enyl]phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.61% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.99% | 96.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 93.71% | 90.20% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.02% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.01% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.76% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.86% | 95.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.58% | 98.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.39% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.37% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.81% | 91.49% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.45% | 91.71% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 88.01% | 90.24% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.75% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 87.67% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.01% | 95.89% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 84.79% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.41% | 95.89% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.84% | 96.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.38% | 90.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.07% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Krameria bicolor |
| Krameria erecta |
| Krameria ramosissima |
| PubChem | 162987643 |
| LOTUS | LTS0242846 |
| wikiData | Q105239571 |