4-[1-Hydroxy-2-(2-methoxy-4-prop-1-enylphenoxy)propyl]-2,6-dimethoxyphenol
| Internal ID | 0375d9c5-e253-4f91-b1b6-1ed663d4a27e |
| Taxonomy | Lignans, neolignans and related compounds |
| IUPAC Name | 4-[1-hydroxy-2-(2-methoxy-4-prop-1-enylphenoxy)propyl]-2,6-dimethoxyphenol |
| SMILES (Canonical) | CC=CC1=CC(=C(C=C1)OC(C)C(C2=CC(=C(C(=C2)OC)O)OC)O)OC |
| SMILES (Isomeric) | CC=CC1=CC(=C(C=C1)OC(C)C(C2=CC(=C(C(=C2)OC)O)OC)O)OC |
| InChI | InChI=1S/C21H26O6/c1-6-7-14-8-9-16(17(10-14)24-3)27-13(2)20(22)15-11-18(25-4)21(23)19(12-15)26-5/h6-13,20,22-23H,1-5H3 |
| InChI Key | DIEIEAKVQCTJFH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.17293854 g/mol |
| Topological Polar Surface Area (TPSA) | 77.40 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of 4-[1-Hydroxy-2-(2-methoxy-4-prop-1-enylphenoxy)propyl]-2,6-dimethoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/4-1-hydroxy-2-2-methoxy-4-prop-1-enylphenoxypropyl-26-dimethoxyphenol.jpg "2D Structure of 4-[1-Hydroxy-2-(2-methoxy-4-prop-1-enylphenoxy)propyl]-2,6-dimethoxyphenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.57% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.88% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.80% | 91.11% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.48% | 90.20% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.12% | 98.95% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.03% | 89.62% |
| CHEMBL3194 | P02766 | Transthyretin | 88.97% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.59% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.47% | 94.45% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.99% | 90.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 87.74% | 90.24% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.11% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.86% | 85.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.44% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.90% | 89.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.21% | 93.31% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.75% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.28% | 94.73% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.58% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Myristica fragrans |
| PubChem | 73834300 |
| LOTUS | LTS0177606 |
| wikiData | Q104981200 |