(3Z)-9-Methyl-3-undecene
| Internal ID | cd0c3c06-2d5c-449f-bf93-949e5c5b22d3 |
| Taxonomy | Hydrocarbons > Unsaturated hydrocarbons > Unsaturated aliphatic hydrocarbons |
| IUPAC Name | 9-methylundec-3-ene |
| SMILES (Canonical) | CCC=CCCCCC(C)CC |
| SMILES (Isomeric) | CCC=CCCCCC(C)CC |
| InChI | InChI=1S/C12H24/c1-4-6-7-8-9-10-11-12(3)5-2/h6-7,12H,4-5,8-11H2,1-3H3 |
| InChI Key | RTETXCZSLJTHLA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.187800766 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 5.50 |
| 74630-50-5 |
| DTXSID50338683 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 91.57% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.63% | 99.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.45% | 96.47% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.37% | 96.09% |
| CHEMBL239 | Q07869 | Peroxisome proliferator-activated receptor alpha | 84.44% | 90.75% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 83.81% | 87.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.73% | 93.56% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.68% | 97.29% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 81.95% | 94.66% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.37% | 93.31% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.21% | 89.34% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.84% | 96.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.01% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glycyrrhiza glabra |
| PubChem | 550666 |
| LOTUS | LTS0140564 |
| wikiData | Q82107270 |