(3~{S},4~{S})-4-(1,3-benzodioxol-5-ylmethyl)-3-[(3,4,5-trimethoxyphenyl)methyl]oxolan-2-one
Internal ID | 824f117f-52d7-4d00-85b4-9a26a1b23c4a |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans > Tetrahydrofuran lignans > 9,9-epoxylignans > Dibenzylbutyrolactone lignans |
IUPAC Name | (3S,4S)-4-(1,3-benzodioxol-5-ylmethyl)-3-[(3,4,5-trimethoxyphenyl)methyl]oxolan-2-one |
SMILES (Canonical) | COC1=CC(=CC(=C1OC)OC)CC2C(COC2=O)CC3=CC4=C(C=C3)OCO4 |
SMILES (Isomeric) | COC1=CC(=CC(=C1OC)OC)C[C@H]2[C@@H](COC2=O)CC3=CC4=C(C=C3)OCO4 |
InChI | InChI=1S/C22H24O7/c1-24-19-9-14(10-20(25-2)21(19)26-3)7-16-15(11-27-22(16)23)6-13-4-5-17-18(8-13)29-12-28-17/h4-5,8-10,15-16H,6-7,11-12H2,1-3H3/t15-,16+/m1/s1 |
InChI Key | GMLDZDDTZKXJLU-CVEARBPZSA-N |
Popularity | 5 references in papers |
Molecular Formula | C22H24O7 |
Molecular Weight | 400.40 g/mol |
Exact Mass | 400.15220310 g/mol |
Topological Polar Surface Area (TPSA) | 72.50 Ų |
XlogP | 3.80 |
YTC |
CHEMBL2021357 |
![2D Structure of (3~{S},4~{S})-4-(1,3-benzodioxol-5-ylmethyl)-3-[(3,4,5-trimethoxyphenyl)methyl]oxolan-2-one 2D Structure of (3~{S},4~{S})-4-(1,3-benzodioxol-5-ylmethyl)-3-[(3,4,5-trimethoxyphenyl)methyl]oxolan-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/3s4s-4-13-benzodioxol-5-ylmethyl-3-345-trimethoxyphenylmethyloxolan-2-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.20% | 83.82% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.34% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.98% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.94% | 96.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 95.73% | 92.62% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.63% | 91.11% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 95.53% | 94.80% |
CHEMBL2581 | P07339 | Cathepsin D | 95.47% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.65% | 85.14% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 90.39% | 96.76% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.27% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.63% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.39% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.71% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.65% | 99.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.01% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.04% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.88% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.05% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.08% | 97.25% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 81.26% | 82.67% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.85% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.24% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bursera schlechtendalii |
Bursera simaruba |
Calocedrus formosana |
PubChem | 10476098 |
LOTUS | LTS0214280 |
wikiData | Q105012011 |