(3S,4R)-4-hydroxy-3,6-dimethyl-3,4-dihydro-2H-naphthalen-1-one
Internal ID | 4122d744-a8bb-4f5b-83ef-26f7fdc7de98 |
Taxonomy | Benzenoids > Tetralins |
IUPAC Name | (3S,4R)-4-hydroxy-3,6-dimethyl-3,4-dihydro-2H-naphthalen-1-one |
SMILES (Canonical) | CC1CC(=O)C2=C(C1O)C=C(C=C2)C |
SMILES (Isomeric) | C[C@H]1CC(=O)C2=C([C@@H]1O)C=C(C=C2)C |
InChI | InChI=1S/C12H14O2/c1-7-3-4-9-10(5-7)12(14)8(2)6-11(9)13/h3-5,8,12,14H,6H2,1-2H3/t8-,12+/m0/s1 |
InChI Key | VZXVULZANASHHG-QPUJVOFHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C12H14O2 |
Molecular Weight | 190.24 g/mol |
Exact Mass | 190.099379685 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 1.70 |
There are no found synonyms. |
![2D Structure of (3S,4R)-4-hydroxy-3,6-dimethyl-3,4-dihydro-2H-naphthalen-1-one 2D Structure of (3S,4R)-4-hydroxy-3,6-dimethyl-3,4-dihydro-2H-naphthalen-1-one](https://plantaedb.com/storage/docs/compounds/2023/11/3s4r-4-hydroxy-36-dimethyl-34-dihydro-2h-naphthalen-1-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.49% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.88% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.03% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.48% | 96.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.66% | 90.71% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.43% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.40% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.01% | 85.14% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 82.47% | 92.51% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.70% | 86.33% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.67% | 86.00% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.43% | 90.93% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.31% | 93.03% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.12% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pyrola rotundifolia |
PubChem | 10352512 |
LOTUS | LTS0170082 |
wikiData | Q105300038 |