(3R)-3-hydroxy-5-phenylpent-4-enoic acid
Internal ID | 8f3f3a83-5317-4562-b514-a5021840410a |
Taxonomy | Phenylpropanoids and polyketides > Cinnamyl alcohols |
IUPAC Name | (E,3R)-3-hydroxy-5-phenylpent-4-enoic acid |
SMILES (Canonical) | C1=CC=C(C=C1)C=CC(CC(=O)O)O |
SMILES (Isomeric) | C1=CC=C(C=C1)/C=C/[C@@H](CC(=O)O)O |
InChI | InChI=1S/C11H12O3/c12-10(8-11(13)14)7-6-9-4-2-1-3-5-9/h1-7,10,12H,8H2,(H,13,14)/b7-6+/t10-/m0/s1 |
InChI Key | JKDYSKHGCXBPQC-FGEFZZPRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C11H12O3 |
Molecular Weight | 192.21 g/mol |
Exact Mass | 192.078644241 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 1.20 |
EN300-1862433 |
70681-39-9 |
![2D Structure of (3R)-3-hydroxy-5-phenylpent-4-enoic acid 2D Structure of (3R)-3-hydroxy-5-phenylpent-4-enoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/3r-3-hydroxy-5-phenylpent-4-enoic-acid.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 94.86% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.29% | 96.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.01% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.84% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.25% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.35% | 96.09% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 89.29% | 94.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.99% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.02% | 99.17% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.57% | 94.08% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.29% | 94.73% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 81.25% | 100.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.96% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Avicennia marina |
PubChem | 9990135 |
LOTUS | LTS0196691 |
wikiData | Q105130158 |