[(2S,3R,4S,5S)-2-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-8-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-6-yl]-4,5-dihydroxyoxan-3-yl] (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate
Internal ID | b2fa3286-1e4b-44cd-8a69-5d28c0854e6c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides > Flavonoid 8-C-glycosides |
IUPAC Name | [(2S,3R,4S,5S)-2-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-8-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-6-yl]-4,5-dihydroxyoxan-3-yl] (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C=CC(=O)OC2C(C(COC2C3=C(C(=C4C(=C3O)C(=O)C=C(O4)C5=CC=C(C=C5)O)C6C(C(C(C(O6)CO)O)O)O)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)/C=C/C(=O)O[C@@H]2[C@H]([C@H](CO[C@H]2C3=C(C(=C4C(=C3O)C(=O)C=C(O4)C5=CC=C(C=C5)O)[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)CO)O)O)O)O)O)O |
InChI | InChI=1S/C37H38O18/c1-50-20-9-14(10-21(51-2)28(20)44)3-8-23(42)55-37-27(43)18(41)13-52-36(37)25-30(46)24-17(40)11-19(15-4-6-16(39)7-5-15)53-34(24)26(31(25)47)35-33(49)32(48)29(45)22(12-38)54-35/h3-11,18,22,27,29,32-33,35-39,41,43-49H,12-13H2,1-2H3/b8-3+/t18-,22+,27-,29-,32-,33+,35-,36-,37+/m0/s1 |
InChI Key | LZPTZBKFVPQQHO-HWQXPBHNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H38O18 |
Molecular Weight | 770.70 g/mol |
Exact Mass | 770.20581436 g/mol |
Topological Polar Surface Area (TPSA) | 292.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.77% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.17% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.10% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.84% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.47% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.19% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.91% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.80% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.72% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.71% | 94.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.36% | 86.92% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.17% | 83.82% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.05% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.78% | 94.73% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.33% | 97.14% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.70% | 97.28% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.50% | 99.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.32% | 95.89% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.06% | 91.71% |
CHEMBL3194 | P02766 | Transthyretin | 83.48% | 90.71% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.35% | 93.10% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.33% | 96.21% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.74% | 95.83% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.01% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Triticum aestivum |
PubChem | 163185587 |
LOTUS | LTS0117161 |
wikiData | Q105160062 |