3,4,5-Trihydroxy-2-[[7,8,9,12,13,14,29,30,33,34,35-undecahydroxy-4,17,25,38-tetraoxo-20-(3,4,5-trihydroxybenzoyl)oxy-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32,34,36-dodecaen-27-yl]oxy]benzoic acid
Internal ID | d9619647-ce42-46a3-82c2-46e147914d44 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 3,4,5-trihydroxy-2-[[7,8,9,12,13,14,29,30,33,34,35-undecahydroxy-4,17,25,38-tetraoxo-20-(3,4,5-trihydroxybenzoyl)oxy-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32,34,36-dodecaen-27-yl]oxy]benzoic acid |
SMILES (Canonical) | C1C2C(C3C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O3)O)O)O)O)O)O)OC(=O)C7=CC(=C(C(=C7C8=C(C(=CC(=C8C(=O)O1)OC9=C(C(=C(C=C9C(=O)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1C2C(C3C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O3)O)O)O)O)O)O)OC(=O)C7=CC(=C(C(=C7C8=C(C(=CC(=C8C(=O)O1)OC9=C(C(=C(C=C9C(=O)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C48H32O31/c49-14-1-9(2-15(50)28(14)56)43(68)79-48-41-40(77-45(70)10-3-16(51)30(58)34(62)23(10)24-11(46(71)78-41)4-17(52)31(59)35(24)63)39-22(75-48)8-73-47(72)26-21(74-38-13(42(66)67)6-19(54)33(61)37(38)65)7-20(55)29(57)27(26)25-12(44(69)76-39)5-18(53)32(60)36(25)64/h1-7,22,39-41,48-65H,8H2,(H,66,67) |
InChI Key | BGNFNOUZXZGVSR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H32O31 |
Molecular Weight | 1104.70 g/mol |
Exact Mass | 1104.09275422 g/mol |
Topological Polar Surface Area (TPSA) | 531.00 Ų |
XlogP | 2.40 |
There are no found synonyms. |
![2D Structure of 3,4,5-Trihydroxy-2-[[7,8,9,12,13,14,29,30,33,34,35-undecahydroxy-4,17,25,38-tetraoxo-20-(3,4,5-trihydroxybenzoyl)oxy-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32,34,36-dodecaen-27-yl]oxy]benzoic acid 2D Structure of 3,4,5-Trihydroxy-2-[[7,8,9,12,13,14,29,30,33,34,35-undecahydroxy-4,17,25,38-tetraoxo-20-(3,4,5-trihydroxybenzoyl)oxy-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32,34,36-dodecaen-27-yl]oxy]benzoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/3e71a250-82da-11ee-bad2-bf961fb444ec.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.13% | 91.11% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 96.35% | 83.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.75% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.43% | 86.33% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 93.97% | 95.17% |
CHEMBL3194 | P02766 | Transthyretin | 93.13% | 90.71% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 92.88% | 94.42% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.51% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.49% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.00% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.05% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.00% | 95.56% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.68% | 97.21% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.02% | 96.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.20% | 95.50% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.40% | 96.21% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.47% | 91.19% |
CHEMBL220 | P22303 | Acetylcholinesterase | 82.97% | 94.45% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.58% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 82.56% | 98.95% |
CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 81.43% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.22% | 89.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.75% | 89.34% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.09% | 94.73% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.07% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Stachyurus praecox |
PubChem | 163006583 |
LOTUS | LTS0044958 |
wikiData | Q104935639 |