(3E)-4,8,11,11-tetramethylbicyclo[7.2.0]undec-3-en-5-ol
Internal ID | ccfd51de-8b89-43dd-805f-9d52e19a5515 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | (3E)-4,8,11,11-tetramethylbicyclo[7.2.0]undec-3-en-5-ol |
SMILES (Canonical) | CC1CCC(C(=CCC2C1CC2(C)C)C)O |
SMILES (Isomeric) | CC1CCC(/C(=C/CC2C1CC2(C)C)/C)O |
InChI | InChI=1S/C15H26O/c1-10-6-8-14(16)11(2)5-7-13-12(10)9-15(13,3)4/h5,10,12-14,16H,6-9H2,1-4H3/b11-5+ |
InChI Key | QYGTVPFTIUUDSL-VZUCSPMQSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H26O |
Molecular Weight | 222.37 g/mol |
Exact Mass | 222.198365449 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 3.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.34% | 96.09% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 88.21% | 86.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.51% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.48% | 83.82% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.05% | 97.09% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.85% | 93.56% |
CHEMBL1871 | P10275 | Androgen Receptor | 84.32% | 96.43% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.11% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.27% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.91% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.60% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Daucus carota |
PubChem | 5370247 |
LOTUS | LTS0076367 |
wikiData | Q105230130 |