3-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
Internal ID | b82235b1-e856-4bd1-9a51-f18c1919d3dc |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 3-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)OC4C(C(C(C(O4)CO)O)O)O)C5=CC=C(C=C5)O)OC6C(C(C(C(O6)CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C5=CC=C(C=C5)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)O |
InChI | InChI=1S/C33H40O20/c1-10-19(38)25(44)30(53-32-27(46)24(43)21(40)17(9-35)51-32)33(47-10)52-29-22(41)18-14(37)6-13(48-31-26(45)23(42)20(39)16(8-34)50-31)7-15(18)49-28(29)11-2-4-12(36)5-3-11/h2-7,10,16-17,19-21,23-27,30-40,42-46H,8-9H2,1H3/t10-,16+,17+,19-,20+,21+,23-,24-,25+,26+,27+,30+,31+,32-,33-/m0/s1 |
InChI Key | HJJIIDXKQCWRHQ-ZBUDETBLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H40O20 |
Molecular Weight | 756.70 g/mol |
Exact Mass | 756.21129366 g/mol |
Topological Polar Surface Area (TPSA) | 324.00 Ų |
XlogP | -2.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.35% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.83% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 97.56% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.20% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.34% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.78% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.05% | 94.73% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.00% | 95.64% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.52% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.34% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.19% | 86.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.94% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.82% | 85.14% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.57% | 97.36% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.86% | 95.56% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.75% | 95.78% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.76% | 97.09% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 84.35% | 98.35% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.96% | 93.10% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.01% | 95.89% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.76% | 96.21% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.35% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Crocus chrysanthus |
Mentha longifolia subsp. longifolia |
PubChem | 101036572 |
LOTUS | LTS0170562 |
wikiData | Q105029289 |