[(2S,3S,4R,5S,6R)-2-[5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)chromen-3-yl]oxy-5-hydroxy-6-methyl-3-(3,4,5-trihydroxybenzoyl)oxyoxan-4-yl] 3,4,5-trihydroxybenzoate
Internal ID | 9fca8928-3e86-48b7-aa76-dbdb8da68ff9 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | [(2S,3S,4R,5S,6R)-2-[5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)chromen-3-yl]oxy-5-hydroxy-6-methyl-3-(3,4,5-trihydroxybenzoyl)oxyoxan-4-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O)OC(=O)C6=CC(=C(C(=C6)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O)OC(=O)C6=CC(=C(C(=C6)O)O)O)O |
InChI | InChI=1S/C35H28O20/c1-10-24(44)30(53-33(49)12-4-18(40)26(46)19(41)5-12)32(54-34(50)13-6-20(42)27(47)21(43)7-13)35(51-10)55-31-28(48)23-15(37)8-14(36)9-22(23)52-29(31)11-2-16(38)25(45)17(39)3-11/h2-10,24,30,32,35-47H,1H3/t10-,24+,30-,32+,35+/m1/s1 |
InChI Key | LVXYMZGTAWDELZ-DRAWQSCOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H28O20 |
Molecular Weight | 768.60 g/mol |
Exact Mass | 768.11739328 g/mol |
Topological Polar Surface Area (TPSA) | 340.00 Ų |
XlogP | 2.80 |
There are no found synonyms. |
![2D Structure of [(2S,3S,4R,5S,6R)-2-[5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)chromen-3-yl]oxy-5-hydroxy-6-methyl-3-(3,4,5-trihydroxybenzoyl)oxyoxan-4-yl] 3,4,5-trihydroxybenzoate 2D Structure of [(2S,3S,4R,5S,6R)-2-[5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)chromen-3-yl]oxy-5-hydroxy-6-methyl-3-(3,4,5-trihydroxybenzoyl)oxyoxan-4-yl] 3,4,5-trihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/3cdb8320-8557-11ee-baf1-7f6fc6e351fb.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.38% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.45% | 89.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 98.22% | 95.64% |
CHEMBL2581 | P07339 | Cathepsin D | 96.35% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.80% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 94.38% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.12% | 94.00% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 93.03% | 94.42% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.34% | 99.17% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 91.51% | 83.00% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 90.47% | 81.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.25% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.64% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.47% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.89% | 90.00% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 84.11% | 97.53% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.39% | 95.78% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.47% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.31% | 95.56% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 80.62% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.37% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Acacia confusa |
PubChem | 162894630 |
LOTUS | LTS0070226 |
wikiData | Q105158126 |