3-[(2R,3S,4R,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one
Internal ID | 385e5d3a-0e6f-4ab1-80c3-0efdd552a548 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 3-[(2R,3S,4R,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)OC4C(C(C(O4)C(C)O)O)O)C5=CC=C(C=C5)O)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)O[C@@H]4[C@H]([C@H]([C@@H](O4)[C@H](C)O)O)O)C5=CC=C(C=C5)O)O)O)O)O |
InChI | InChI=1S/C27H30O14/c1-9(28)23-20(34)22(36)27(40-23)41-25-18(32)16-14(30)7-13(38-26-21(35)19(33)17(31)10(2)37-26)8-15(16)39-24(25)11-3-5-12(29)6-4-11/h3-10,17,19-23,26-31,33-36H,1-2H3/t9-,10+,17+,19-,20+,21-,22-,23-,26+,27+/m0/s1 |
InChI Key | PUXKQFMZRYJBBE-ZJBBONHWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O14 |
Molecular Weight | 578.50 g/mol |
Exact Mass | 578.16355563 g/mol |
Topological Polar Surface Area (TPSA) | 225.00 Ų |
XlogP | 0.50 |
There are no found synonyms. |
![2D Structure of 3-[(2R,3S,4R,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one 2D Structure of 3-[(2R,3S,4R,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/3b4decf0-86dd-11ee-9350-7fbb4ced0a21.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.24% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.71% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.99% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.94% | 85.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.21% | 99.15% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.49% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.51% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.98% | 94.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.95% | 90.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.14% | 95.64% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.59% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.54% | 96.09% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 88.06% | 98.35% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.90% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.03% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.19% | 94.45% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.87% | 95.78% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.43% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.51% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.74% | 95.89% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 81.26% | 85.31% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.10% | 93.65% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.09% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.55% | 99.23% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.06% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Prunus spinosa |
PubChem | 162890785 |
LOTUS | LTS0188753 |
wikiData | Q105215340 |