(2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-5-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)-2-[[(1R,2S,4S,6R,7S,8R,9S,12S,13S,16S)-6-hydroxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 9c897ee0-8f8f-464c-b320-2b15121e8759 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-5-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)-2-[[(1R,2S,4S,6R,7S,8R,9S,12S,13S,16S)-6-hydroxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)OC1(CCC(C)COC1C(C(C(C(O1)CO)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CCC5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)CO)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)C)O[C@@]1(CC[C@@H](C)CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
InChI | InChI=1S/C56H94O27/c1-21(19-73-49-42(68)40(66)37(63)31(16-57)77-49)8-13-56(72)22(2)34-30(83-56)15-28-26-7-6-24-14-25(9-11-54(24,4)27(26)10-12-55(28,34)5)76-53-48(82-51-43(69)39(65)35(61)23(3)75-51)44(70)46(33(18-59)79-53)80-52-45(71)47(38(64)32(17-58)78-52)81-50-41(67)36(62)29(60)20-74-50/h21-53,57-72H,6-20H2,1-5H3/t21-,22+,23+,24?,25+,26-,27+,28+,29-,30+,31-,32-,33-,34+,35+,36+,37-,38-,39-,40+,41-,42-,43-,44+,45-,46+,47+,48-,49-,50+,51+,52+,53-,54+,55+,56-/m1/s1 |
InChI Key | GSEZEQCURJEOHO-BFKSSZHFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C56H94O27 |
Molecular Weight | 1199.30 g/mol |
Exact Mass | 1198.59824772 g/mol |
Topological Polar Surface Area (TPSA) | 425.00 Ų |
XlogP | -2.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.55% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.19% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.03% | 95.93% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.02% | 92.86% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.69% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.24% | 96.61% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.61% | 97.93% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 93.34% | 97.29% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.27% | 94.45% |
CHEMBL237 | P41145 | Kappa opioid receptor | 91.47% | 98.10% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 91.39% | 95.36% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.97% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.54% | 100.00% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 90.27% | 98.05% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 90.16% | 97.86% |
CHEMBL204 | P00734 | Thrombin | 89.96% | 96.01% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 89.52% | 89.05% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.52% | 96.21% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 89.16% | 95.58% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 88.55% | 92.98% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.81% | 95.89% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 87.65% | 97.31% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 87.16% | 92.78% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.99% | 89.00% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.91% | 93.18% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.67% | 92.94% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 86.40% | 98.46% |
CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 86.16% | 87.38% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 85.86% | 97.50% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.58% | 92.88% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 84.94% | 97.64% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.86% | 91.24% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.82% | 86.33% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.65% | 93.56% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.39% | 96.77% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.52% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.04% | 95.50% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 82.76% | 92.32% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.63% | 95.89% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.63% | 91.71% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 81.83% | 97.79% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 81.73% | 95.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.29% | 94.75% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 81.03% | 80.33% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 80.79% | 96.67% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 80.78% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.76% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.30% | 92.50% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 80.18% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chlorophytum borivilianum |
PubChem | 102034151 |
LOTUS | LTS0082648 |
wikiData | Q104400311 |