3-[4,5-Dihydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
Internal ID | 1411788e-f688-4353-a2a4-ff87bf0c7ce5 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 3-[4,5-dihydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=C(C2=O)C(=CC(=C3CC=C(C)C)OC4C(C(C(C(O4)CO)O)O)O)O)C5=CC=C(C=C5)OC)OC6C(C(C(CO6)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=C(OC3=C(C2=O)C(=CC(=C3CC=C(C)C)OC4C(C(C(C(O4)CO)O)O)O)O)C5=CC=C(C=C5)OC)OC6C(C(C(CO6)O)O)O)O)O |
InChI | InChI=1S/C38H48O19/c1-14(2)5-10-18-21(53-37-31(49)28(46)26(44)22(12-39)54-37)11-19(40)23-27(45)34(32(55-33(18)23)16-6-8-17(50-4)9-7-16)56-38-35(29(47)24(42)15(3)52-38)57-36-30(48)25(43)20(41)13-51-36/h5-9,11,15,20,22,24-26,28-31,35-44,46-49H,10,12-13H2,1-4H3 |
InChI Key | OCZZCFAOOWZSRX-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C38H48O19 |
Molecular Weight | 808.80 g/mol |
Exact Mass | 808.27897930 g/mol |
Topological Polar Surface Area (TPSA) | 293.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
![2D Structure of 3-[4,5-Dihydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one 2D Structure of 3-[4,5-Dihydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/39ca4a40-861b-11ee-bcb8-3dd406d03527.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.93% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.86% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.11% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.30% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.87% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.01% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.98% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.35% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.83% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.77% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.51% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.32% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.69% | 96.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.51% | 86.92% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.74% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.23% | 92.94% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.73% | 90.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.08% | 97.36% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.75% | 96.09% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.68% | 95.83% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.13% | 95.89% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.69% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Epimedium sagittatum |
Vancouveria hexandra |
PubChem | 13916058 |
LOTUS | LTS0161786 |
wikiData | Q105189676 |