[(8R)-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-8-yl] acetate
Internal ID | f743d7fb-1c46-4321-94b6-18c0f79d9e79 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(8R)-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-8-yl] acetate |
SMILES (Canonical) | CC1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4C(C1C)OC(=O)C)OC)OC)OC)OC)OCO3 |
SMILES (Isomeric) | CC1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4[C@@H](C1C)OC(=O)C)OC)OC)OC)OC)OCO3 |
InChI | InChI=1S/C25H30O8/c1-12-8-15-9-18-23(32-11-31-18)24(29-6)19(15)20-16(21(13(12)2)33-14(3)26)10-17(27-4)22(28-5)25(20)30-7/h9-10,12-13,21H,8,11H2,1-7H3/t12?,13?,21-/m1/s1 |
InChI Key | GRHNKVUUWRVFMM-LFCMPWLRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H30O8 |
Molecular Weight | 458.50 g/mol |
Exact Mass | 458.19406791 g/mol |
Topological Polar Surface Area (TPSA) | 81.70 Ų |
XlogP | 4.60 |
There are no found synonyms. |
![2D Structure of [(8R)-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-8-yl] acetate 2D Structure of [(8R)-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-8-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/07/39a0e670-2416-11ee-bcbb-01e4f9c5f58f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.80% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.60% | 96.09% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 95.05% | 96.76% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.36% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.00% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.70% | 86.33% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 91.64% | 89.50% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.41% | 96.77% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.84% | 99.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.47% | 92.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.30% | 95.89% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.55% | 94.80% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 88.10% | 82.67% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.72% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.56% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 85.33% | 98.75% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 84.86% | 95.62% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.51% | 91.19% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 84.22% | 96.86% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.56% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.70% | 96.95% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.16% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Achyranthes bidentata |
Schisandra chinensis |
Schisandra neglecta |
Schisandra rubriflora |
PubChem | 5321020 |
NPASS | NPC135594 |
LOTUS | LTS0071741 |
wikiData | Q105107200 |