(1R,9S,11R)-1,11,12-trimethyl-6-phenyl-8,10-dioxa-4-azatricyclo[7.4.0.02,7]trideca-2(7),5,12-trien-3-one
| Internal ID | 03788d6d-a9f7-43b7-ae1e-981935afbc91 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Phenylpyridines |
| IUPAC Name | (1R,9S,11R)-1,11,12-trimethyl-6-phenyl-8,10-dioxa-4-azatricyclo[7.4.0.02,7]trideca-2(7),5,12-trien-3-one |
| SMILES (Canonical) | CC1C(=CC2(C(O1)OC3=C2C(=O)NC=C3C4=CC=CC=C4)C)C |
| SMILES (Isomeric) | C[C@@H]1C(=C[C@]2([C@@H](O1)OC3=C2C(=O)NC=C3C4=CC=CC=C4)C)C |
| InChI | InChI=1S/C19H19NO3/c1-11-9-19(3)15-16(23-18(19)22-12(11)2)14(10-20-17(15)21)13-7-5-4-6-8-13/h4-10,12,18H,1-3H3,(H,20,21)/t12-,18+,19-/m1/s1 |
| InChI Key | PXSYKUIWENRRCE-ZUSMLRIVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13649347 g/mol |
| Topological Polar Surface Area (TPSA) | 47.60 Ų |
| XlogP | 2.20 |
| There are no found synonyms. |
![2D Structure of (1R,9S,11R)-1,11,12-trimethyl-6-phenyl-8,10-dioxa-4-azatricyclo[7.4.0.02,7]trideca-2(7),5,12-trien-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/39871580-80f8-11ee-8d5e-3fd40384986e.jpg "2D Structure of (1R,9S,11R)-1,11,12-trimethyl-6-phenyl-8,10-dioxa-4-azatricyclo[7.4.0.02,7]trideca-2(7),5,12-trien-3-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.00% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.08% | 98.95% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 90.89% | 93.31% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.30% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.15% | 99.23% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 87.77% | 96.25% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.35% | 93.03% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.77% | 96.09% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 86.48% | 83.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.18% | 90.17% |
| CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 84.55% | 95.55% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.70% | 89.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.86% | 91.11% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 80.86% | 95.48% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.30% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pueraria montana var. lobata |
| Spartium junceum |
| PubChem | 163024621 |
| LOTUS | LTS0063343 |
| wikiData | Q105247292 |