(2S,3aS,9R,9aR)-9-hydroxy-2-(2-hydroxypropan-2-yl)-3,3a,9,9a-tetrahydro-2H-benzo[f][1]benzofuran-4-one
Internal ID | 2fb1955b-555d-4c2a-ad29-b9cf7ef1ff5e |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | (2S,3aS,9R,9aR)-9-hydroxy-2-(2-hydroxypropan-2-yl)-3,3a,9,9a-tetrahydro-2H-benzo[f][1]benzofuran-4-one |
SMILES (Canonical) | CC(C)(C1CC2C(O1)C(C3=CC=CC=C3C2=O)O)O |
SMILES (Isomeric) | CC(C)([C@@H]1C[C@H]2[C@@H](O1)[C@@H](C3=CC=CC=C3C2=O)O)O |
InChI | InChI=1S/C15H18O4/c1-15(2,18)11-7-10-12(16)8-5-3-4-6-9(8)13(17)14(10)19-11/h3-6,10-11,13-14,17-18H,7H2,1-2H3/t10-,11+,13-,14-/m1/s1 |
InChI Key | BVAYYWKYGJBBHG-ZMJPVWNMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H18O4 |
Molecular Weight | 262.30 g/mol |
Exact Mass | 262.12050905 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 0.60 |
There are no found synonyms. |
![2D Structure of (2S,3aS,9R,9aR)-9-hydroxy-2-(2-hydroxypropan-2-yl)-3,3a,9,9a-tetrahydro-2H-benzo[f][1]benzofuran-4-one 2D Structure of (2S,3aS,9R,9aR)-9-hydroxy-2-(2-hydroxypropan-2-yl)-3,3a,9,9a-tetrahydro-2H-benzo[f][1]benzofuran-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/397b1530-85cd-11ee-9df5-6daab8647cf0.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.08% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.97% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.41% | 83.82% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.65% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.59% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.17% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.32% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.14% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.61% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.36% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.48% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.37% | 85.14% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 82.01% | 90.93% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.83% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Avicennia marina |
PubChem | 16737083 |
LOTUS | LTS0267916 |
wikiData | Q104946433 |