3,9,10-Trimethoxybenzo[c]chromen-6-one
| Internal ID | 446e5586-9d38-47a3-8b06-091b90e8e402 |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
| IUPAC Name | 3,9,10-trimethoxybenzo[c]chromen-6-one |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C3=C(C=CC(=C3OC)OC)C(=O)O2 |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=C(C=CC(=C3OC)OC)C(=O)O2 |
| InChI | InChI=1S/C16H14O5/c1-18-9-4-5-10-13(8-9)21-16(17)11-6-7-12(19-2)15(20-3)14(10)11/h4-8H,1-3H3 |
| InChI Key | TYNPXQCRAYBXPN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08412354 g/mol |
| Topological Polar Surface Area (TPSA) | 54.00 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
![2D Structure of 3,9,10-Trimethoxybenzo[c]chromen-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/3910-trimethoxybenzocchromen-6-one.jpg "2D Structure of 3,9,10-Trimethoxybenzo[c]chromen-6-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.78% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.52% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.95% | 95.56% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 89.04% | 93.31% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.55% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.59% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.15% | 89.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.88% | 98.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.55% | 96.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.16% | 94.73% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 82.77% | 92.51% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.38% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.27% | 90.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.50% | 96.67% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.54% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Acacia fasciculifera |
| Umtiza listeriana |
| PubChem | 86011203 |
| LOTUS | LTS0180552 |
| wikiData | Q105267441 |