(2S,3R,4S,5S,6R)-2-[(Z,2S)-2-[(3S,5S,7S,8R,9R,10S,13R,14R,17S)-3,7-dihydroxy-8-(hydroxymethyl)-4,4,10,14-tetramethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-7-hydroxy-6-methylhept-5-en-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
| Internal ID | 8e840487-95eb-4403-aeae-ee7048d89b20 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(Z,2S)-2-[(3S,5S,7S,8R,9R,10S,13R,14R,17S)-3,7-dihydroxy-8-(hydroxymethyl)-4,4,10,14-tetramethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-7-hydroxy-6-methylhept-5-en-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | CC(=CCCC(C)(C1CCC2(C1CCC3C2(C(CC4C3(CCC(C4(C)C)O)C)O)CO)C)OC5C(C(C(C(O5)CO)O)O)O)CO |
| SMILES (Isomeric) | C/C(=C/CC[C@@](C)([C@H]1CC[C@@]2([C@@H]1CC[C@H]3[C@]2([C@H](C[C@H]4[C@@]3(CC[C@@H](C4(C)C)O)C)O)CO)C)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)/CO |
| InChI | InChI=1S/C36H62O10/c1-20(17-37)8-7-13-35(6,46-31-30(44)29(43)28(42)23(18-38)45-31)22-11-15-34(5)21(22)9-10-24-33(4)14-12-26(40)32(2,3)25(33)16-27(41)36(24,34)19-39/h8,21-31,37-44H,7,9-19H2,1-6H3/b20-8-/t21-,22+,23-,24-,25-,26+,27+,28-,29+,30-,31+,33-,34-,35+,36+/m1/s1 |
| InChI Key | HGYRBMZHJGVFPT-OGYWNDFZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C36H62O10 |
| Molecular Weight | 654.90 g/mol |
| Exact Mass | 654.43429817 g/mol |
| Topological Polar Surface Area (TPSA) | 180.00 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.99% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.08% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.85% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.82% | 96.09% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.05% | 96.61% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.72% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.56% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.06% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.33% | 98.95% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.81% | 95.50% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.19% | 97.79% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.99% | 95.93% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 83.75% | 100.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.48% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.47% | 93.00% |
| CHEMBL233 | P35372 | Mu opioid receptor | 82.49% | 97.93% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.91% | 95.38% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.85% | 97.36% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.82% | 100.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 80.64% | 98.10% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.55% | 92.62% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.38% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Actinostemma tenerum |
| PubChem | 162886966 |
| LOTUS | LTS0218068 |
| wikiData | Q105028080 |