[(10R,11S,12R,13S,15R)-3,4,5,13,21,22,23-heptahydroxy-8,18-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-12-yl] 5-[[(1R,2S,19R,20R,22R)-7,8,9,12,13,20,28,29,30,33,34,35-dodecahydroxy-4,17,25,38-tetraoxo-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32,34,36-dodecaen-14-yl]oxy]-2,3,4-trihydroxybenzoate
Internal ID | 195c96ca-6645-4381-8596-a63d1e016bc4 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(10R,11S,12R,13S,15R)-3,4,5,13,21,22,23-heptahydroxy-8,18-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-12-yl] 5-[[(1R,2S,19R,20R,22R)-7,8,9,12,13,20,28,29,30,33,34,35-dodecahydroxy-4,17,25,38-tetraoxo-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32,34,36-dodecaen-14-yl]oxy]-2,3,4-trihydroxybenzoate |
SMILES (Canonical) | C1C2C(C3C(C(O2)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O3)O)O)O)O)O)OC6=C(C(=C(C(=C6)C(=O)OC7C(C8C(COC(=O)C9=CC(=C(C(=C9C2=C(C(=C(C=C2C(=O)O8)O)O)O)O)O)O)OC7O)OC(=O)C2=CC(=C(C(=C2)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@H]3[C@H]([C@@H](O2)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O3)O)O)O)O)O)OC6=C(C(=C(C(=C6)C(=O)O[C@@H]7[C@H]([C@H]8[C@@H](COC(=O)C9=CC(=C(C(=C9C2=C(C(=C(C=C2C(=O)O8)O)O)O)O)O)O)O[C@@H]7O)OC(=O)C2=CC(=C(C(=C2)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
InChI | InChI=1S/C68H48O44/c69-20-1-12(2-21(70)38(20)77)59(92)109-55-53-29(10-102-60(93)13-3-22(71)39(78)46(85)31(13)33-15(62(95)107-53)5-24(73)41(80)48(33)87)105-67(100)57(55)112-66(99)19-9-28(45(84)52(91)37(19)76)104-27-8-18-36(51(90)44(27)83)35-17(7-26(75)43(82)50(35)89)64(97)110-56-54-30(106-68(101)58(56)111-65(18)98)11-103-61(94)14-4-23(72)40(79)47(86)32(14)34-16(63(96)108-54)6-25(74)42(81)49(34)88/h1-9,29-30,53-58,67-91,100-101H,10-11H2/t29-,30-,53-,54-,55+,56+,57-,58-,67+,68-/m1/s1 |
InChI Key | HTTUWLIGHWGDPI-ZLHQAKSLSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C68H48O44 |
Molecular Weight | 1569.10 g/mol |
Exact Mass | 1568.1518448 g/mol |
Topological Polar Surface Area (TPSA) | 744.00 Ų |
XlogP | 2.70 |
There are no found synonyms. |
![2D Structure of [(10R,11S,12R,13S,15R)-3,4,5,13,21,22,23-heptahydroxy-8,18-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-12-yl] 5-[[(1R,2S,19R,20R,22R)-7,8,9,12,13,20,28,29,30,33,34,35-dodecahydroxy-4,17,25,38-tetraoxo-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32,34,36-dodecaen-14-yl]oxy]-2,3,4-trihydroxybenzoate 2D Structure of [(10R,11S,12R,13S,15R)-3,4,5,13,21,22,23-heptahydroxy-8,18-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-12-yl] 5-[[(1R,2S,19R,20R,22R)-7,8,9,12,13,20,28,29,30,33,34,35-dodecahydroxy-4,17,25,38-tetraoxo-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32,34,36-dodecaen-14-yl]oxy]-2,3,4-trihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/37a93da0-86d3-11ee-84a9-33f9f3d0fd0d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.67% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.37% | 91.49% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 93.94% | 83.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.92% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 92.19% | 90.71% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 91.85% | 95.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.57% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.88% | 95.56% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.67% | 97.21% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 89.44% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.92% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.43% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.25% | 89.00% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 87.06% | 94.42% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.94% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.64% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.52% | 95.50% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.02% | 96.38% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.91% | 96.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.54% | 90.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.52% | 91.19% |
CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 83.19% | 100.00% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.84% | 89.63% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.63% | 93.40% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.14% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.64% | 98.95% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 81.50% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.35% | 97.09% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 80.90% | 83.57% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Camellia japonica |
PubChem | 163191854 |
LOTUS | LTS0085783 |
wikiData | Q105033605 |