[(2R,3R,4S,5S,6R)-4,5-dihydroxy-2-[(1S,2R)-2-hydroxycyclohexyl]oxy-6-(hydroxymethyl)oxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 39ee6b32-a5c9-43e4-a9d7-8c183a0aa84d |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Hydroxycinnamic acid esters > Coumaric acid esters |
IUPAC Name | [(2R,3R,4S,5S,6R)-4,5-dihydroxy-2-[(1S,2R)-2-hydroxycyclohexyl]oxy-6-(hydroxymethyl)oxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1CCC(C(C1)O)OC2C(C(C(C(O2)CO)O)O)OC(=O)C=CC3=CC=C(C=C3)O |
SMILES (Isomeric) | C1CC[C@@H]([C@@H](C1)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)OC(=O)C=CC3=CC=C(C=C3)O |
InChI | InChI=1S/C21H28O9/c22-11-16-18(26)19(27)20(21(29-16)28-15-4-2-1-3-14(15)24)30-17(25)10-7-12-5-8-13(23)9-6-12/h5-10,14-16,18-24,26-27H,1-4,11H2/t14-,15+,16-,18-,19+,20-,21-/m1/s1 |
InChI Key | ZTMPDTJBTNGZJH-HYCSIWNGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H28O9 |
Molecular Weight | 424.40 g/mol |
Exact Mass | 424.17333247 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
![2D Structure of [(2R,3R,4S,5S,6R)-4,5-dihydroxy-2-[(1S,2R)-2-hydroxycyclohexyl]oxy-6-(hydroxymethyl)oxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate 2D Structure of [(2R,3R,4S,5S,6R)-4,5-dihydroxy-2-[(1S,2R)-2-hydroxycyclohexyl]oxy-6-(hydroxymethyl)oxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/3753a5a0-8740-11ee-b6ba-8531f59ee475.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.78% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.41% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.43% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.17% | 96.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.94% | 95.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.18% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.08% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.81% | 89.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 88.77% | 89.67% |
CHEMBL2581 | P07339 | Cathepsin D | 86.26% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.24% | 92.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.78% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 83.41% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.82% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.36% | 99.17% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.72% | 91.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.19% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Populus grandidentata |
PubChem | 162917111 |
LOTUS | LTS0080194 |
wikiData | Q105383027 |