3,7'-Epoxy-4,8'-oxyneolignan
Internal ID | a28b98b2-c429-4d96-b5dc-e2f6240f728d |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | 4-[2-(hydroxymethyl)-6-(3-hydroxypropyl)-2,3-dihydro-1,4-benzodioxin-3-yl]-2-methoxyphenol |
SMILES (Canonical) | COC1=C(C=CC(=C1)C2C(OC3=C(O2)C=C(C=C3)CCCO)CO)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C2C(OC3=C(O2)C=C(C=C3)CCCO)CO)O |
InChI | InChI=1S/C19H22O6/c1-23-16-10-13(5-6-14(16)22)19-18(11-21)24-15-7-4-12(3-2-8-20)9-17(15)25-19/h4-7,9-10,18-22H,2-3,8,11H2,1H3 |
InChI Key | VSJGYMSTWHUFMX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H22O6 |
Molecular Weight | 346.40 g/mol |
Exact Mass | 346.14163842 g/mol |
Topological Polar Surface Area (TPSA) | 88.40 Ų |
XlogP | 2.10 |
4',9,9'-Trihydroxy-3'-methoxy- |
4',9,9'-Trihydroxy-3'-methoxy- 3,7'-epoxy-4,8'-oxyneolignan |
![2D Structure of 3,7'-Epoxy-4,8'-oxyneolignan 2D Structure of 3,7'-Epoxy-4,8'-oxyneolignan](https://plantaedb.com/storage/docs/compounds/2023/11/37-epoxy-48-oxyneolignan.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.81% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.44% | 96.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 95.32% | 86.92% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.16% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 91.95% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.44% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.27% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.34% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.34% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.96% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.33% | 97.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.00% | 95.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.34% | 92.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.60% | 95.89% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 80.02% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Juniperus chinensis |
Santalum album |
PubChem | 72829871 |
LOTUS | LTS0207288 |
wikiData | Q105292255 |