2-[2-(3,12-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-methylhept-5-en-2-yl]oxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxane-3,4,5-triol
Internal ID | 5de52c8e-06cc-432a-885d-dbae82c8ac12 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 2-[2-(3,12-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-methylhept-5-en-2-yl]oxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxane-3,4,5-triol |
SMILES (Canonical) | CC(=CCCC(C)(C1CCC2(C1C(CC3C2(CCC4C3(CCC(C4(C)C)O)C)C)O)C)OC5C(C(C(C(O5)COC6C(C(C(CO6)O)O)O)O)O)O)C |
SMILES (Isomeric) | CC(=CCCC(C)(C1CCC2(C1C(CC3C2(CCC4C3(CCC(C4(C)C)O)C)C)O)C)OC5C(C(C(C(O5)COC6C(C(C(CO6)O)O)O)O)O)O)C |
InChI | InChI=1S/C41H70O12/c1-21(2)10-9-14-41(8,53-36-34(49)32(47)31(46)25(52-36)20-51-35-33(48)30(45)24(43)19-50-35)22-11-16-40(7)29(22)23(42)18-27-38(5)15-13-28(44)37(3,4)26(38)12-17-39(27,40)6/h10,22-36,42-49H,9,11-20H2,1-8H3 |
InChI Key | YNBYFOIDLBTOMW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H70O12 |
Molecular Weight | 755.00 g/mol |
Exact Mass | 754.48672766 g/mol |
Topological Polar Surface Area (TPSA) | 199.00 Ų |
XlogP | 3.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.43% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.65% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.40% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.75% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.56% | 82.69% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 90.96% | 85.31% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.96% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.85% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.78% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.98% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.89% | 95.89% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.91% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.24% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 85.36% | 98.95% |
CHEMBL5028 | O14672 | ADAM10 | 83.50% | 97.50% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.39% | 96.61% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.09% | 96.90% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.75% | 94.75% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.32% | 97.21% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.25% | 97.36% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 81.90% | 100.00% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 81.71% | 92.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.98% | 92.62% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 80.86% | 97.78% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.83% | 96.43% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 80.52% | 80.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.04% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Centella asiatica |
PubChem | 15574836 |
LOTUS | LTS0217594 |
wikiData | Q105350880 |