1-[2-[8-[1-Acetyl-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1,2-dihydroxyoctyl]piperidin-1-yl]ethanone
Internal ID | a4053361-2db5-4ede-8861-e3d65e82c170 |
Taxonomy | Organoheterocyclic compounds > Piperidines > N-acylpiperidines |
IUPAC Name | 1-[2-[8-[1-acetyl-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1,2-dihydroxyoctyl]piperidin-1-yl]ethanone |
SMILES (Canonical) | CC(=O)N1CCCCC1C(C(CCCCCCC2C(C(C(N2C(=O)C)CO)O)O)O)O |
SMILES (Isomeric) | CC(=O)N1CCCCC1C(C(CCCCCCC2C(C(C(N2C(=O)C)CO)O)O)O)O |
InChI | InChI=1S/C22H40N2O7/c1-14(26)23-12-8-7-9-16(23)20(29)19(28)11-6-4-3-5-10-17-21(30)22(31)18(13-25)24(17)15(2)27/h16-22,25,28-31H,3-13H2,1-2H3 |
InChI Key | YIEPZDPKKNJALX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H40N2O7 |
Molecular Weight | 444.60 g/mol |
Exact Mass | 444.28355162 g/mol |
Topological Polar Surface Area (TPSA) | 142.00 Ų |
XlogP | -0.10 |
Atomic LogP (AlogP) | -0.24 |
H-Bond Acceptor | 7 |
H-Bond Donor | 5 |
Rotatable Bonds | 10 |
There are no found synonyms. |
![2D Structure of 1-[2-[8-[1-Acetyl-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1,2-dihydroxyoctyl]piperidin-1-yl]ethanone 2D Structure of 1-[2-[8-[1-Acetyl-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-1,2-dihydroxyoctyl]piperidin-1-yl]ethanone](https://plantaedb.com/storage/docs/compounds/2023/11/367575d0-82c5-11ee-b478-e9bb81b4ad96.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.7483 | 74.83% |
Caco-2 | - | 0.7502 | 75.02% |
Blood Brain Barrier | - | 0.7500 | 75.00% |
Human oral bioavailability | - | 0.6429 | 64.29% |
Subcellular localzation | Mitochondria | 0.7623 | 76.23% |
OATP2B1 inhibitior | - | 0.7115 | 71.15% |
OATP1B1 inhibitior | + | 0.9305 | 93.05% |
OATP1B3 inhibitior | + | 0.9326 | 93.26% |
MATE1 inhibitior | - | 0.9212 | 92.12% |
OCT2 inhibitior | - | 0.8750 | 87.50% |
BSEP inhibitior | + | 0.5855 | 58.55% |
P-glycoprotein inhibitior | - | 0.6415 | 64.15% |
P-glycoprotein substrate | + | 0.5370 | 53.70% |
CYP3A4 substrate | + | 0.6427 | 64.27% |
CYP2C9 substrate | - | 0.8144 | 81.44% |
CYP2D6 substrate | - | 0.8400 | 84.00% |
CYP3A4 inhibition | - | 0.9885 | 98.85% |
CYP2C9 inhibition | - | 0.9391 | 93.91% |
CYP2C19 inhibition | - | 0.9588 | 95.88% |
CYP2D6 inhibition | - | 0.9550 | 95.50% |
CYP1A2 inhibition | - | 0.9660 | 96.60% |
CYP2C8 inhibition | - | 0.9090 | 90.90% |
CYP inhibitory promiscuity | - | 0.9873 | 98.73% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.8800 | 88.00% |
Carcinogenicity (trinary) | Non-required | 0.6570 | 65.70% |
Eye corrosion | - | 0.9884 | 98.84% |
Eye irritation | - | 0.9112 | 91.12% |
Skin irritation | - | 0.7841 | 78.41% |
Skin corrosion | - | 0.9352 | 93.52% |
Ames mutagenesis | - | 0.8100 | 81.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7141 | 71.41% |
Micronuclear | + | 0.8200 | 82.00% |
Hepatotoxicity | - | 0.6343 | 63.43% |
skin sensitisation | - | 0.9075 | 90.75% |
Respiratory toxicity | + | 0.5556 | 55.56% |
Reproductive toxicity | + | 0.7889 | 78.89% |
Mitochondrial toxicity | + | 0.8500 | 85.00% |
Nephrotoxicity | + | 0.6310 | 63.10% |
Acute Oral Toxicity (c) | III | 0.5862 | 58.62% |
Estrogen receptor binding | - | 0.4949 | 49.49% |
Androgen receptor binding | - | 0.5332 | 53.32% |
Thyroid receptor binding | - | 0.6363 | 63.63% |
Glucocorticoid receptor binding | - | 0.6530 | 65.30% |
Aromatase binding | - | 0.7093 | 70.93% |
PPAR gamma | - | 0.6407 | 64.07% |
Honey bee toxicity | - | 0.9044 | 90.44% |
Biodegradation | - | 0.7000 | 70.00% |
Crustacea aquatic toxicity | - | 0.6938 | 69.38% |
Fish aquatic toxicity | - | 0.8766 | 87.66% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.33% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 98.56% | 98.95% |
CHEMBL237 | P41145 | Kappa opioid receptor | 97.73% | 98.10% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.45% | 91.19% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 92.67% | 98.33% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.91% | 93.56% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.15% | 90.08% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.55% | 95.50% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.82% | 97.25% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.39% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.11% | 92.50% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.73% | 96.77% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 87.67% | 97.86% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.62% | 96.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.34% | 97.09% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 86.97% | 91.81% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.44% | 94.45% |
CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 86.33% | 97.43% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.98% | 98.75% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.64% | 92.86% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.46% | 99.17% |
CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 85.35% | 95.52% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 85.22% | 97.47% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.09% | 99.18% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 85.07% | 92.32% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.91% | 94.33% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.79% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.56% | 95.89% |
CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 84.53% | 98.77% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.26% | 95.89% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.58% | 94.00% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 82.18% | 95.36% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 81.82% | 92.97% |
CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 81.68% | 93.33% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.14% | 97.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Broussonetia papyrifera |
PubChem | 53462569 |
LOTUS | LTS0236224 |
wikiData | Q105348790 |