beta-D-Glucopyranoside, (3beta,6alpha,12beta)-3,12,17-trihydroxy-6-(beta-D-xylopyranosyloxy)dammar-24-en-20-yl O-6-deoxy-alpha-L-mannopyranosyl-(1-->6)-O-[beta-D-glucopyranosyl-(1-->2)]-
Internal ID | d664548a-fb7f-44c2-af28-655841f76e1c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (2R,3R,4R,5R,6S)-2-[[(2R,3S,4S,5R,6S)-3,4-dihydroxy-6-[(2S)-6-methyl-2-[(3S,5R,6S,8R,9R,10R,12R,13R,14R,17R)-3,12,17-trihydroxy-4,4,8,10,14-pentamethyl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-1,2,3,5,6,7,9,11,12,13,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]hept-5-en-2-yl]oxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methoxy]-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC(C)(CCC=C(C)C)C3(CCC4(C3C(CC5C4(CC(C6C5(CCC(C6(C)C)O)C)OC7C(C(C(CO7)O)O)O)C)O)C)O)OC8C(C(C(C(O8)CO)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O[C@@](C)(CCC=C(C)C)[C@]3(CC[C@@]4([C@@H]3[C@@H](C[C@H]5[C@]4(C[C@@H]([C@@H]6[C@@]5(CC[C@@H](C6(C)C)O)C)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)C)O)C)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C53H90O23/c1-22(2)11-10-13-52(9,76-47-41(75-46-40(67)36(63)33(60)27(19-54)73-46)37(64)34(61)28(74-47)21-70-44-39(66)35(62)31(58)23(3)71-44)53(68)16-15-50(7)42(53)24(55)17-29-49(6)14-12-30(57)48(4,5)43(49)26(18-51(29,50)8)72-45-38(65)32(59)25(56)20-69-45/h11,23-47,54-68H,10,12-21H2,1-9H3/t23-,24+,25+,26-,27+,28+,29+,30-,31-,32-,33+,34+,35+,36-,37-,38+,39+,40+,41+,42-,43-,44+,45-,46-,47-,49+,50+,51+,52-,53+/m0/s1 |
InChI Key | OZEDEQJLFBHIEM-RRRCVURHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C53H90O23 |
Molecular Weight | 1095.30 g/mol |
Exact Mass | 1094.58728911 g/mol |
Topological Polar Surface Area (TPSA) | 377.00 Ų |
XlogP | -1.70 |
251101-56-1 |
beta-D-Glucopyranoside, (3beta,6alpha,12beta)-3,12,17-trihydroxy-6-(beta-D-xylopyranosyloxy)dammar-24-en-20-yl O-6-deoxy-alpha-L-mannopyranosyl-(1-->6)-O-[beta-D-glucopyranosyl-(1-->2)]- |
![2D Structure of beta-D-Glucopyranoside, (3beta,6alpha,12beta)-3,12,17-trihydroxy-6-(beta-D-xylopyranosyloxy)dammar-24-en-20-yl O-6-deoxy-alpha-L-mannopyranosyl-(1-->6)-O-[beta-D-glucopyranosyl-(1-->2)]- 2D Structure of beta-D-Glucopyranoside, (3beta,6alpha,12beta)-3,12,17-trihydroxy-6-(beta-D-xylopyranosyloxy)dammar-24-en-20-yl O-6-deoxy-alpha-L-mannopyranosyl-(1-->6)-O-[beta-D-glucopyranosyl-(1-->2)]-](https://plantaedb.com/storage/docs/compounds/2023/11/35d640c0-861b-11ee-b1fd-07bc9e4202bf.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.24% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.00% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 98.12% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.25% | 97.09% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 94.94% | 95.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.20% | 94.75% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 91.84% | 95.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.28% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.16% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.55% | 92.94% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.02% | 96.61% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.83% | 100.00% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 88.46% | 92.50% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 88.19% | 95.58% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.55% | 96.09% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.50% | 96.90% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 86.97% | 95.38% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 86.59% | 95.83% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.24% | 100.00% |
CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 85.98% | 92.86% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 85.44% | 100.00% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 84.86% | 97.86% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.79% | 95.89% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 84.68% | 99.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 84.49% | 96.43% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.37% | 92.97% |
CHEMBL2581 | P07339 | Cathepsin D | 84.25% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.02% | 89.00% |
CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 83.38% | 98.57% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.18% | 93.18% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.11% | 97.33% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.10% | 97.79% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.10% | 91.03% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.20% | 94.45% |
CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 82.11% | 96.11% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.80% | 90.08% |
CHEMBL2094128 | P24941 | Cyclin-dependent kinase 2/cyclin A | 81.63% | 97.25% |
CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 | 81.29% | 95.52% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.72% | 92.88% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.62% | 98.75% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.40% | 97.28% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.38% | 90.24% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 80.35% | 96.67% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.22% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cyclanthera pedata |
PubChem | 100997709 |
LOTUS | LTS0125711 |
wikiData | Q105203717 |