[(1R,2S,3S,5S,6S,7R,8R,9S,11R,13S,14R,16S,18R)-7,16-diacetyloxy-14-[(S)-acetyloxy(furan-3-yl)methyl]-3-hydroxy-13,18-bis(2-methoxy-2-oxoethyl)-2,5,11,14-tetramethyl-8-propanoyloxy-10,12,17-trioxahexacyclo[9.5.1.12,5.01,9.03,7.09,13]octadecan-6-yl] (2R,3S)-2,3-dimethyloxirane-2-carboxylate
| Internal ID | 4710ac98-7624-4432-9f02-bae654f791c5 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Eicosanoids > Prostaglandins and related compounds |
| IUPAC Name | [(1R,2S,3S,5S,6S,7R,8R,9S,11R,13S,14R,16S,18R)-7,16-diacetyloxy-14-[(S)-acetyloxy(furan-3-yl)methyl]-3-hydroxy-13,18-bis(2-methoxy-2-oxoethyl)-2,5,11,14-tetramethyl-8-propanoyloxy-10,12,17-trioxahexacyclo[9.5.1.12,5.01,9.03,7.09,13]octadecan-6-yl] (2R,3S)-2,3-dimethyloxirane-2-carboxylate |
| SMILES (Canonical) | CCC(=O)OC1C2(C(C3(CC2(C(C3CC(=O)OC)(C45C16C(C(CC4OC(=O)C)(C)C(C7=COC=C7)OC(=O)C)(OC(O5)(O6)C)CC(=O)OC)C)O)C)OC(=O)C8(C(O8)C)C)OC(=O)C |
| SMILES (Isomeric) | CCC(=O)O[C@@H]1[C@@]2([C@H]([C@]3(C[C@@]2([C@]([C@@H]3CC(=O)OC)([C@]45[C@@]16[C@]([C@@](C[C@@H]4OC(=O)C)(C)[C@H](C7=COC=C7)OC(=O)C)(O[C@](O5)(O6)C)CC(=O)OC)C)O)C)OC(=O)[C@]8([C@@H](O8)C)C)OC(=O)C |
| InChI | InChI=1S/C44H56O20/c1-13-28(48)58-33-42(61-24(5)47)32(59-34(51)37(8)21(2)60-37)35(6)20-40(42,52)38(9,26(35)16-29(49)53-11)43-27(56-22(3)45)17-36(7,31(57-23(4)46)25-14-15-55-19-25)41(18-30(50)54-12)44(33,43)64-39(10,62-41)63-43/h14-15,19,21,26-27,31-33,52H,13,16-18,20H2,1-12H3/t21-,26+,27-,31-,32-,33+,35-,36+,37+,38-,39+,40-,41-,42+,43-,44-/m0/s1 |
| InChI Key | GGDXKDBYBCWLOW-PCUZQHHLSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C44H56O20 |
| Molecular Weight | 904.90 g/mol |
| Exact Mass | 904.33649417 g/mol |
| Topological Polar Surface Area (TPSA) | 258.00 Ų |
| XlogP | 1.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.55% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.30% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.71% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.25% | 94.45% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 93.92% | 92.29% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.06% | 90.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.59% | 90.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.07% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.01% | 89.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.56% | 96.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.11% | 97.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.07% | 94.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.39% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.37% | 95.89% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.35% | 89.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.94% | 93.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.46% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.34% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.44% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.15% | 86.33% |
| CHEMBL5028 | O14672 | ADAM10 | 81.50% | 97.50% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.18% | 83.82% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.93% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Swietenia macrophylla |
| PubChem | 162976278 |
| LOTUS | LTS0124166 |
| wikiData | Q105007980 |