3,5-Dimethoxy-2-(5-prop-1-enyl-1-benzofuran-2-yl)phenol
Internal ID | 39b36865-392f-4d6d-8e07-5cb1de290edc |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 3,5-dimethoxy-2-(5-prop-1-enyl-1-benzofuran-2-yl)phenol |
SMILES (Canonical) | CC=CC1=CC2=C(C=C1)OC(=C2)C3=C(C=C(C=C3OC)OC)O |
SMILES (Isomeric) | CC=CC1=CC2=C(C=C1)OC(=C2)C3=C(C=C(C=C3OC)OC)O |
InChI | InChI=1S/C19H18O4/c1-4-5-12-6-7-16-13(8-12)9-18(23-16)19-15(20)10-14(21-2)11-17(19)22-3/h4-11,20H,1-3H3 |
InChI Key | ZVUKDEUIFQUXQP-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C19H18O4 |
Molecular Weight | 310.30 g/mol |
Exact Mass | 310.12050905 g/mol |
Topological Polar Surface Area (TPSA) | 51.80 Ų |
XlogP | 4.60 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.62% | 91.11% |
CHEMBL4208 | P20618 | Proteasome component C5 | 93.11% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.74% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.51% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.29% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.16% | 99.15% |
CHEMBL3194 | P02766 | Transthyretin | 91.99% | 90.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.30% | 85.14% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 88.24% | 90.24% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.16% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.98% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.80% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.44% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.19% | 94.73% |
CHEMBL2535 | P11166 | Glucose transporter | 82.87% | 98.75% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.00% | 95.50% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.63% | 93.65% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.07% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Krameria erecta |
Krameria ramosissima |
PubChem | 86159972 |
LOTUS | LTS0211582 |
wikiData | Q104995472 |