Fimbriol A
| Internal ID | 16efbd6e-0c23-4e78-acd1-cffee5a9e823 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
| IUPAC Name | 3,4,9-trimethoxyphenanthrene-2,5-diol |
| SMILES (Canonical) | COC1=CC2=CC(=C(C(=C2C3=C1C=CC=C3O)OC)OC)O |
| SMILES (Isomeric) | COC1=CC2=CC(=C(C(=C2C3=C1C=CC=C3O)OC)OC)O |
| InChI | InChI=1S/C17H16O5/c1-20-13-8-9-7-12(19)16(21-2)17(22-3)14(9)15-10(13)5-4-6-11(15)18/h4-8,18-19H,1-3H3 |
| InChI Key | MRYYPHKLLLULDL-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 68.20 Ų |
| XlogP | 3.60 |
| 3,4,9-trimethoxyphenanthrene-2,5-diol |
| CHEMBL2208382 |
| 2,5-dihydroxy-3,4,9-trimethoxyphenanthrene |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.95% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.06% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.94% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.87% | 86.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.42% | 93.99% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.04% | 90.20% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.81% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.51% | 94.75% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.51% | 99.15% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.88% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.58% | 98.95% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 86.47% | 93.31% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 83.89% | 94.03% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.61% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dendrobium plicatile |
| Epidendrum rigidum |
| Maxillaria densa |
| PubChem | 11335575 |
| LOTUS | LTS0230899 |
| wikiData | Q103815910 |