3,4,6,8-tetrahydroxy-1-[(2S)-4-methyl-5-oxo-2H-furan-2-yl]xanthen-9-one
| Internal ID | 57ada3df-3bb4-4656-94d8-24e086c818fa |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 3,4,6,8-tetrahydroxy-1-[(2S)-4-methyl-5-oxo-2H-furan-2-yl]xanthen-9-one |
| SMILES (Canonical) | CC1=CC(OC1=O)C2=CC(=C(C3=C2C(=O)C4=C(C=C(C=C4O3)O)O)O)O |
| SMILES (Isomeric) | CC1=C[C@H](OC1=O)C2=CC(=C(C3=C2C(=O)C4=C(C=C(C=C4O3)O)O)O)O |
| InChI | InChI=1S/C18H12O8/c1-6-2-11(26-18(6)24)8-5-10(21)15(22)17-13(8)16(23)14-9(20)3-7(19)4-12(14)25-17/h2-5,11,19-22H,1H3/t11-/m0/s1 |
| InChI Key | FNWVTNYGGFPWNK-NSHDSACASA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H12O8 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.05321734 g/mol |
| Topological Polar Surface Area (TPSA) | 134.00 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
![2D Structure of 3,4,6,8-tetrahydroxy-1-[(2S)-4-methyl-5-oxo-2H-furan-2-yl]xanthen-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/3468-tetrahydroxy-1-2s-4-methyl-5-oxo-2h-furan-2-ylxanthen-9-one.jpg "2D Structure of 3,4,6,8-tetrahydroxy-1-[(2S)-4-methyl-5-oxo-2H-furan-2-yl]xanthen-9-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.20% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.97% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.92% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.86% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.98% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.41% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.45% | 94.00% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 87.39% | 96.12% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.12% | 86.33% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 87.11% | 91.38% |
| CHEMBL3194 | P02766 | Transthyretin | 85.54% | 90.71% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.45% | 93.65% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 83.91% | 95.64% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 82.57% | 94.42% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.26% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Garcinia xanthochymus |
| PubChem | 162869359 |
| LOTUS | LTS0129286 |
| wikiData | Q104998588 |