[3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl] 8-hydroxy-2,6-dimethyloct-2-enoate
| Internal ID | 18db4aca-5a0b-40ae-969a-adec56bb474b |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
| IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 8-hydroxy-2,6-dimethyloct-2-enoate |
| SMILES (Canonical) | CC(CCC=C(C)C(=O)OC1C(C(C(C(O1)CO)O)O)O)CCO |
| SMILES (Isomeric) | CC(CCC=C(C)C(=O)OC1C(C(C(C(O1)CO)O)O)O)CCO |
| InChI | InChI=1S/C16H28O8/c1-9(6-7-17)4-3-5-10(2)15(22)24-16-14(21)13(20)12(19)11(8-18)23-16/h5,9,11-14,16-21H,3-4,6-8H2,1-2H3 |
| InChI Key | IVQLNJTZWHCVDN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H28O8 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.17841785 g/mol |
| Topological Polar Surface Area (TPSA) | 137.00 Ų |
| XlogP | 0.10 |
| There are no found synonyms. |
![2D Structure of [3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl] 8-hydroxy-2,6-dimethyloct-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/345-trihydroxy-6-hydroxymethyloxan-2-yl-8-hydroxy-26-dimethyloct-2-enoate.jpg "2D Structure of [3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl] 8-hydroxy-2,6-dimethyloct-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.57% | 96.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.71% | 96.47% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.51% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.66% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.95% | 98.95% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 89.86% | 97.47% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.33% | 99.17% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.52% | 97.36% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.65% | 93.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.88% | 96.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.66% | 98.75% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.92% | 92.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.88% | 89.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.73% | 96.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.13% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sambucus ebulus |
| PubChem | 73806975 |
| LOTUS | LTS0126029 |
| wikiData | Q105121231 |