[(8R,9S,10R,11R)-11-acetyloxy-14-hydroxy-3,4,5,15,16-pentamethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] benzoate
| Internal ID | 1e07f31b-a444-4627-9b5d-92432b80bb7d |
| Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
| IUPAC Name | [(8R,9S,10R,11R)-11-acetyloxy-14-hydroxy-3,4,5,15,16-pentamethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] benzoate |
| SMILES (Canonical) | CC1C(C(C2=CC(=C(C(=C2C3=C(C(=C(C=C3C1OC(=O)C)O)OC)OC)OC)OC)OC)OC(=O)C4=CC=CC=C4)C |
| SMILES (Isomeric) | C[C@@H]1[C@@H]([C@H](C2=CC(=C(C(=C2C3=C(C(=C(C=C3[C@@H]1OC(=O)C)O)OC)OC)OC)OC)OC)OC(=O)C4=CC=CC=C4)C |
| InChI | InChI=1S/C32H36O10/c1-16-17(2)27(42-32(35)19-12-10-9-11-13-19)21-15-23(36-4)29(38-6)31(40-8)25(21)24-20(26(16)41-18(3)33)14-22(34)28(37-5)30(24)39-7/h9-17,26-27,34H,1-8H3/t16-,17+,26-,27-/m1/s1 |
| InChI Key | NMPZHFWAYKMXML-ACVUGXNCSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H36O10 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.23084734 g/mol |
| Topological Polar Surface Area (TPSA) | 119.00 Ų |
| XlogP | 5.50 |
| There are no found synonyms. |
![2D Structure of [(8R,9S,10R,11R)-11-acetyloxy-14-hydroxy-3,4,5,15,16-pentamethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/343e5680-8413-11ee-a764-a9397414327b.jpg "2D Structure of [(8R,9S,10R,11R)-11-acetyloxy-14-hydroxy-3,4,5,15,16-pentamethoxy-9,10-dimethyl-8-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] benzoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.26% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.53% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 94.51% | 98.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.16% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.06% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.16% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.92% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.61% | 99.23% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 82.56% | 91.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.50% | 91.19% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.99% | 94.62% |
| CHEMBL240 | Q12809 | HERG | 81.28% | 89.76% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.79% | 85.14% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.77% | 91.49% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.54% | 97.21% |
| CHEMBL5028 | O14672 | ADAM10 | 80.51% | 97.50% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.24% | 94.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Kadsura coccinea |
| PubChem | 53388921 |
| LOTUS | LTS0231830 |
| wikiData | Q105181910 |