3,4-dihydroxy-7-methylidene-2-penta-1,3-dienyl-3,4-dihydro-2H-pyrano[2,3-c]pyrrol-5-one
| Internal ID | 7718bd58-51bb-4a08-80ac-10a0f47a1f11 |
| Taxonomy | Organoheterocyclic compounds > Pyrrolines |
| IUPAC Name | 3,4-dihydroxy-7-methylidene-2-penta-1,3-dienyl-3,4-dihydro-2H-pyrano[2,3-c]pyrrol-5-one |
| SMILES (Canonical) | CC=CC=CC1C(C(C2=C(O1)C(=C)NC2=O)O)O |
| SMILES (Isomeric) | CC=CC=CC1C(C(C2=C(O1)C(=C)NC2=O)O)O |
| InChI | InChI=1S/C13H15NO4/c1-3-4-5-6-8-10(15)11(16)9-12(18-8)7(2)14-13(9)17/h3-6,8,10-11,15-16H,2H2,1H3,(H,14,17) |
| InChI Key | YLNPAYTZVSONSH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.10010796 g/mol |
| Topological Polar Surface Area (TPSA) | 78.80 Ų |
| XlogP | -0.20 |
| There are no found synonyms. |
![2D Structure of 3,4-dihydroxy-7-methylidene-2-penta-1,3-dienyl-3,4-dihydro-2H-pyrano[2,3-c]pyrrol-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/34-dihydroxy-7-methylidene-2-penta-13-dienyl-34-dihydro-2h-pyrano23-cpyrrol-5-one.jpg "2D Structure of 3,4-dihydroxy-7-methylidene-2-penta-1,3-dienyl-3,4-dihydro-2H-pyrano[2,3-c]pyrrol-5-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.09% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.68% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.20% | 91.11% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.83% | 93.03% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.35% | 99.23% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.35% | 94.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.42% | 94.73% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.17% | 92.88% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.30% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sorbus pallescens |
| PubChem | 73826911 |
| LOTUS | LTS0191713 |
| wikiData | Q104201817 |