3,3,8-trimethyl-11H-pyrano[3,2-a]carbazol-9-ol
| Internal ID | 1ee86c89-940a-416e-aa66-3f0297e895cb |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 3,3,8-trimethyl-11H-pyrano[3,2-a]carbazol-9-ol |
| SMILES (Canonical) | CC1=CC2=C(C=C1O)NC3=C2C=CC4=C3C=CC(O4)(C)C |
| SMILES (Isomeric) | CC1=CC2=C(C=C1O)NC3=C2C=CC4=C3C=CC(O4)(C)C |
| InChI | InChI=1S/C18H17NO2/c1-10-8-13-11-4-5-16-12(6-7-18(2,3)21-16)17(11)19-14(13)9-15(10)20/h4-9,19-20H,1-3H3 |
| InChI Key | PIXPDQLZGFAGST-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.125928785 g/mol |
| Topological Polar Surface Area (TPSA) | 45.20 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
![2D Structure of 3,3,8-trimethyl-11H-pyrano[3,2-a]carbazol-9-ol](https://plantaedb.com/storage/docs/compounds/2023/11/338-trimethyl-11h-pyrano32-acarbazol-9-ol.jpg "2D Structure of 3,3,8-trimethyl-11H-pyrano[3,2-a]carbazol-9-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.23% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.29% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.15% | 91.49% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 96.13% | 93.24% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.90% | 93.40% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.49% | 94.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.97% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.69% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.71% | 93.99% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.49% | 90.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.70% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.35% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.12% | 96.09% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.09% | 91.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.95% | 94.00% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 82.82% | 80.96% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.82% | 94.80% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 82.25% | 91.79% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.62% | 95.56% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.21% | 85.30% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bergera euchrestifolia |
| PubChem | 15060939 |
| LOTUS | LTS0050870 |
| wikiData | Q104398703 |