6-Hydroxy-4-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-5,7-dimethoxy-3,4-dihydronaphthalene-2-carbaldehyde
Internal ID | e2e4b043-cb11-4004-973e-972ae6d2812c |
Taxonomy | Lignans, neolignans and related compounds > Aryltetralin lignans |
IUPAC Name | 6-hydroxy-4-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-5,7-dimethoxy-3,4-dihydronaphthalene-2-carbaldehyde |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2C(C(=CC3=CC(=C(C(=C23)OC)O)OC)C=O)CO |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C2C(C(=CC3=CC(=C(C(=C23)OC)O)OC)C=O)CO |
InChI | InChI=1S/C22H24O8/c1-27-15-7-12(8-16(28-2)20(15)25)18-14(10-24)13(9-23)5-11-6-17(29-3)21(26)22(30-4)19(11)18/h5-9,14,18,24-26H,10H2,1-4H3 |
InChI Key | BMSWDUKHSSOQNO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H24O8 |
Molecular Weight | 416.40 g/mol |
Exact Mass | 416.14711772 g/mol |
Topological Polar Surface Area (TPSA) | 115.00 Ų |
XlogP | 1.90 |
There are no found synonyms. |
![2D Structure of 6-Hydroxy-4-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-5,7-dimethoxy-3,4-dihydronaphthalene-2-carbaldehyde 2D Structure of 6-Hydroxy-4-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-5,7-dimethoxy-3,4-dihydronaphthalene-2-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/32913c60-8421-11ee-94d2-a5ffde7d2dc3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.21% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.18% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.84% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 90.58% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.54% | 95.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.65% | 89.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.91% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.31% | 96.00% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 85.80% | 98.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.47% | 99.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.93% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.98% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.85% | 92.62% |
CHEMBL2535 | P11166 | Glucose transporter | 80.54% | 98.75% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.09% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Avicennia marina |
Lyonia ovalifolia |
PubChem | 75163497 |
LOTUS | LTS0083130 |
wikiData | Q104938548 |