17-(5-ethyl-6-methylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol
Internal ID | 89ebf99c-808c-4043-a309-852a25924fe1 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | 17-(5-ethyl-6-methylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
SMILES (Canonical) | CCC(C=CC(C)C1CCC2C1(CCC3C2=CC=C4C3(CCC(C4)O)C)C)C(C)C |
SMILES (Isomeric) | CCC(C=CC(C)C1CCC2C1(CCC3C2=CC=C4C3(CCC(C4)O)C)C)C(C)C |
InChI | InChI=1S/C29H46O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-11,19-21,23,25-27,30H,7,12-18H2,1-6H3 |
InChI Key | OQMZNAMGEHIHNN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H46O |
Molecular Weight | 410.70 g/mol |
Exact Mass | 410.354866087 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 8.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.78% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.64% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.09% | 95.93% |
CHEMBL2581 | P07339 | Cathepsin D | 93.52% | 98.95% |
CHEMBL1977 | P11473 | Vitamin D receptor | 92.96% | 99.43% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.24% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.77% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.59% | 95.89% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.55% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.62% | 90.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.44% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.02% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.10% | 93.56% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.43% | 82.69% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.10% | 90.71% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.77% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.75% | 92.86% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.23% | 95.56% |
CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 80.56% | 88.81% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asparagus racemosus |
Phellodendron amurense |
Salvia bracteata |
PubChem | 101705 |
LOTUS | LTS0182314 |
wikiData | Q105197035 |