3,15-Dimethyl-5,14-dioxatetracyclo[6.6.1.02,6.012,15]pentadec-2-ene-4,13-dione
| Internal ID | 1f859ea0-b8d3-4d33-87d5-12a5f457f603 |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | 3,15-dimethyl-5,14-dioxatetracyclo[6.6.1.02,6.012,15]pentadec-2-ene-4,13-dione |
| SMILES (Canonical) | CC1=C2C(CC3CCCC4C3(C2OC4=O)C)OC1=O |
| SMILES (Isomeric) | CC1=C2C(CC3CCCC4C3(C2OC4=O)C)OC1=O |
| InChI | InChI=1S/C15H18O4/c1-7-11-10(18-13(7)16)6-8-4-3-5-9-14(17)19-12(11)15(8,9)2/h8-10,12H,3-6H2,1-2H3 |
| InChI Key | XTSBENNQJJYWQF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
![2D Structure of 3,15-Dimethyl-5,14-dioxatetracyclo[6.6.1.02,6.012,15]pentadec-2-ene-4,13-dione](https://plantaedb.com/storage/docs/compounds/2023/11/315-dimethyl-514-dioxatetracyclo66102601215pentadec-2-ene-413-dione.jpg "2D Structure of 3,15-Dimethyl-5,14-dioxatetracyclo[6.6.1.02,6.012,15]pentadec-2-ene-4,13-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.15% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.82% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.22% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.78% | 91.11% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 85.64% | 95.58% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.02% | 97.25% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.23% | 97.14% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.65% | 93.03% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.15% | 91.49% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.59% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.52% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 81.29% | 89.63% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.51% | 92.50% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 80.47% | 97.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Chloranthus anhuiensis |
| Ligularia dolichobotrys |
| Ligularia fauriei |
| Ligularia macrophylla |
| PubChem | 162983072 |
| LOTUS | LTS0053537 |
| wikiData | Q105341882 |