[(2R,3S,4R,5R,6S)-4,5-dihydroxy-2-methyl-6-[[(1S,3R,4S,5S,6R,8S,10R,11S,12S,13R,15R,17R,29R,30S,31S,33R)-4,5,11,12-tetrahydroxy-6-(hydroxymethyl)-33-[(2S,3R)-3-hydroxy-2-methylbutanoyl]oxy-13,31-dimethyl-27-oxo-17-pentyl-2,7,9,14,16,28,32-heptaoxatetracyclo[27.3.1.03,8.010,15]tritriacontan-30-yl]oxy]oxan-3-yl] (2S,3S)-3-hydroxy-2-methylbutanoate
| Internal ID | 3664a8d5-6faf-4fcd-bf6b-fa3ff7fdf4c7 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
| IUPAC Name | [(2R,3S,4R,5R,6S)-4,5-dihydroxy-2-methyl-6-[[(1S,3R,4S,5S,6R,8S,10R,11S,12S,13R,15R,17R,29R,30S,31S,33R)-4,5,11,12-tetrahydroxy-6-(hydroxymethyl)-33-[(2S,3R)-3-hydroxy-2-methylbutanoyl]oxy-13,31-dimethyl-27-oxo-17-pentyl-2,7,9,14,16,28,32-heptaoxatetracyclo[27.3.1.03,8.010,15]tritriacontan-30-yl]oxy]oxan-3-yl] (2S,3S)-3-hydroxy-2-methylbutanoate |
| SMILES (Canonical) | CCCCCC1CCCCCCCCCC(=O)OC2C(C(OC(C2OC(=O)C(C)C(C)O)OC3C(C(C(OC3OC4C(C(C(OC4O1)C)O)O)CO)O)O)C)OC5C(C(C(C(O5)C)OC(=O)C(C)C(C)O)O)O |
| SMILES (Isomeric) | CCCCC[C@@H]1CCCCCCCCCC(=O)O[C@@H]2[C@H]([C@@H](O[C@H]([C@@H]2OC(=O)[C@@H](C)[C@@H](C)O)O[C@@H]3[C@H]([C@@H]([C@H](O[C@H]3O[C@@H]4[C@H]([C@@H]([C@H](O[C@H]4O1)C)O)O)CO)O)O)C)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)C)OC(=O)[C@@H](C)[C@H](C)O)O)O |
| InChI | InChI=1S/C50H86O23/c1-9-10-16-19-30-20-17-14-12-11-13-15-18-21-32(54)68-43-40(71-47-38(60)37(59)39(28(7)64-47)69-45(61)23(2)25(4)52)29(8)65-50(44(43)70-46(62)24(3)26(5)53)73-42-36(58)34(56)31(22-51)67-49(42)72-41-35(57)33(55)27(6)63-48(41)66-30/h23-31,33-44,47-53,55-60H,9-22H2,1-8H3/t23-,24-,25-,26+,27+,28+,29-,30+,31+,33+,34+,35-,36-,37+,38+,39+,40-,41+,42+,43+,44+,47-,48-,49-,50-/m0/s1 |
| InChI Key | NONWDJKCKTUZAI-LRKSIUCPSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C50H86O23 |
| Molecular Weight | 1055.20 g/mol |
| Exact Mass | 1054.55598899 g/mol |
| Topological Polar Surface Area (TPSA) | 335.00 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.12% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.87% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.50% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.34% | 96.09% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 93.49% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.29% | 93.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.00% | 96.47% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.95% | 99.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.36% | 97.09% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.67% | 92.62% |
| CHEMBL4072 | P07858 | Cathepsin B | 90.22% | 93.67% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.98% | 92.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.89% | 89.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 88.80% | 97.79% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.74% | 91.19% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 88.32% | 98.75% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.02% | 94.33% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.65% | 92.88% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.70% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.22% | 90.71% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.43% | 95.50% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 84.31% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.05% | 94.73% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.39% | 96.21% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 82.99% | 90.24% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.92% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.85% | 97.29% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.70% | 96.00% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 82.65% | 98.03% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.40% | 95.83% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.75% | 86.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.60% | 100.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.59% | 96.90% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 81.48% | 97.47% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.24% | 95.56% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 81.17% | 83.00% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 80.88% | 82.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ipomoea orizabensis |
| PubChem | 163024619 |
| LOTUS | LTS0103290 |
| wikiData | Q105182668 |