[(5S,7R,8R,9R,10R,13S,17R)-17-(furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate
Internal ID | 5060433a-712a-4235-ba17-595d96140dda |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | [(5S,7R,8R,9R,10R,13S,17R)-17-(furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate |
SMILES (Canonical) | CC(=O)OC1CC2C(C(=O)C=CC2(C3C1(C4=CCC(C4(CC3)C)C5=COC=C5)C)C)(C)C |
SMILES (Isomeric) | CC(=O)O[C@@H]1C[C@H]2[C@](C=CC(=O)C2(C)C)([C@@H]3[C@@]1(C4=CC[C@H]([C@@]4(CC3)C)C5=COC=C5)C)C |
InChI | InChI=1S/C28H36O4/c1-17(29)32-24-15-22-25(2,3)23(30)10-13-27(22,5)21-9-12-26(4)19(18-11-14-31-16-18)7-8-20(26)28(21,24)6/h8,10-11,13-14,16,19,21-22,24H,7,9,12,15H2,1-6H3/t19-,21+,22+,24+,26-,27+,28-/m0/s1 |
InChI Key | XXIKKMLIDXLAIK-IZSBMLLGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H36O4 |
Molecular Weight | 436.60 g/mol |
Exact Mass | 436.26135963 g/mol |
Topological Polar Surface Area (TPSA) | 56.50 Ų |
XlogP | 5.70 |
There are no found synonyms. |
![2D Structure of [(5S,7R,8R,9R,10R,13S,17R)-17-(furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate 2D Structure of [(5S,7R,8R,9R,10R,13S,17R)-17-(furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/31315860-84df-11ee-8118-93ccef7ae913.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.87% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.29% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.49% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.15% | 94.45% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.43% | 82.69% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.63% | 91.19% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.26% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.53% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.37% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.17% | 85.14% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.16% | 93.04% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.04% | 97.28% |
CHEMBL2581 | P07339 | Cathepsin D | 84.02% | 98.95% |
CHEMBL5028 | O14672 | ADAM10 | 83.11% | 97.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.39% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.04% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.93% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.35% | 97.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.95% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Toona sinensis |
PubChem | 161837612 |
LOTUS | LTS0080940 |
wikiData | Q105344025 |