31-Norcyclolaudenone
Internal ID | 0e9c90ef-be43-4186-851e-c48d0573f59a |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
IUPAC Name | 15-(5,6-dimethylhept-6-en-2-yl)-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-one |
SMILES (Canonical) | CC1C2CCC3C4(CCC(C4(CCC35C2(C5)CCC1=O)C)C(C)CCC(C)C(=C)C)C |
SMILES (Isomeric) | CC1C2CCC3C4(CCC(C4(CCC35C2(C5)CCC1=O)C)C(C)CCC(C)C(=C)C)C |
InChI | InChI=1S/C30H48O/c1-19(2)20(3)8-9-21(4)23-12-14-28(7)26-11-10-24-22(5)25(31)13-15-29(24)18-30(26,29)17-16-27(23,28)6/h20-24,26H,1,8-18H2,2-7H3 |
InChI Key | RCXORQWZHHYMBR-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C30H48O |
Molecular Weight | 424.70 g/mol |
Exact Mass | 424.370516150 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 9.70 |
30452-60-9 |
31-Norcyclolaudenone |
24-Methyl-29-norcycloart-25-en-3-one |
CID 91886690 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.88% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.87% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.61% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 95.34% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.49% | 96.09% |
CHEMBL233 | P35372 | Mu opioid receptor | 90.06% | 97.93% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.28% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.18% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.12% | 94.45% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.75% | 94.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.74% | 97.09% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.97% | 93.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.70% | 90.71% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.04% | 90.08% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.45% | 96.61% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.96% | 100.00% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.66% | 94.78% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.44% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Musa × paradisiaca |
PubChem | 85199928 |
LOTUS | LTS0130764 |
wikiData | Q104396708 |