2-[2-Hydroxy-3,8,8,17,19-pentamethyl-9-(3,4,5-trihydroxyoxan-2-yl)oxy-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosan-22-yl]propan-2-yl acetate
Internal ID | 4b20597a-fa32-4100-bf6a-2a077ce1c164 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
IUPAC Name | 2-[2-hydroxy-3,8,8,17,19-pentamethyl-9-(3,4,5-trihydroxyoxan-2-yl)oxy-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosan-22-yl]propan-2-yl acetate |
SMILES (Canonical) | CC1CC2C(OC3(C1C4(CCC56CC57CCC(C(C7CCC6C4(C3O)C)(C)C)OC8C(C(C(CO8)O)O)O)C)O2)C(C)(C)OC(=O)C |
SMILES (Isomeric) | CC1CC2C(OC3(C1C4(CCC56CC57CCC(C(C7CCC6C4(C3O)C)(C)C)OC8C(C(C(CO8)O)O)O)C)O2)C(C)(C)OC(=O)C |
InChI | InChI=1S/C37H58O10/c1-18-15-21-28(32(5,6)45-19(2)38)47-37(46-21)27(18)33(7)13-14-36-17-35(36)12-11-24(44-29-26(41)25(40)20(39)16-43-29)31(3,4)22(35)9-10-23(36)34(33,8)30(37)42/h18,20-30,39-42H,9-17H2,1-8H3 |
InChI Key | NNFJPOSVDKIWPO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H58O10 |
Molecular Weight | 662.80 g/mol |
Exact Mass | 662.40299804 g/mol |
Topological Polar Surface Area (TPSA) | 144.00 Ų |
XlogP | 4.30 |
27994-12-3 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.10% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.97% | 91.11% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.54% | 96.77% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.78% | 96.09% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 93.17% | 89.34% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.20% | 92.94% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.65% | 91.19% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 91.53% | 98.75% |
CHEMBL2581 | P07339 | Cathepsin D | 90.73% | 98.95% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.28% | 96.95% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 89.63% | 92.88% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.57% | 97.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.09% | 97.14% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.77% | 85.14% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.16% | 96.61% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.15% | 91.24% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.90% | 82.69% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 86.68% | 95.71% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.56% | 89.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.20% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.14% | 100.00% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 84.81% | 95.92% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.51% | 97.05% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.46% | 86.33% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 83.35% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.32% | 95.89% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 82.86% | 98.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.76% | 95.56% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 82.55% | 95.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.11% | 92.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.97% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.83% | 91.07% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 81.22% | 95.71% |
CHEMBL3837 | P07711 | Cathepsin L | 80.29% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Actaea asiatica |
Actaea cimicifuga |
Actaea dahurica |
Actaea pachypoda |
Actaea racemosa |
Actaea simplex |
Actaea yunnanensis |
PubChem | 72799835 |
LOTUS | LTS0091370 |
wikiData | Q105182110 |