7-[4,5-Dihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)chromen-4-one
Internal ID | af1fe7fc-80ec-4c07-8d41-f36572b100fc |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 7-[4,5-dihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)chromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)OC6C(C(C(CO6)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)OC6C(C(C(CO6)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C33H40O18/c1-12-23(37)26(40)29(43)31(47-12)46-11-21-25(39)27(41)30(51-32-28(42)24(38)18(36)10-45-32)33(50-21)48-15-7-16(34)22-17(35)9-19(49-20(22)8-15)13-3-5-14(44-2)6-4-13/h3-9,12,18,21,23-34,36-43H,10-11H2,1-2H3 |
InChI Key | QBYFCXBVWQQXFH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H40O18 |
Molecular Weight | 724.70 g/mol |
Exact Mass | 724.22146442 g/mol |
Topological Polar Surface Area (TPSA) | 273.00 Ų |
XlogP | -2.00 |
There are no found synonyms. |
![2D Structure of 7-[4,5-Dihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)chromen-4-one 2D Structure of 7-[4,5-Dihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/30e2e060-85fb-11ee-a577-0dadfc6ba81a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.85% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.58% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.92% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.79% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 96.88% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.80% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.25% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.89% | 99.15% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.42% | 97.36% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.82% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.24% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.44% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.22% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.79% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.23% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.70% | 95.89% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.64% | 93.31% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.51% | 95.93% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.48% | 96.77% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.41% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.53% | 95.89% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 81.75% | 80.33% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 80.62% | 87.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Robinia pseudoacacia |
PubChem | 163089838 |
LOTUS | LTS0110385 |
wikiData | Q105218091 |