(2R,3S,4S,5R,6R)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoxy]oxane-3,4,5-triol
Internal ID | da21e796-8223-46f2-be25-354561392fb3 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
IUPAC Name | (2R,3S,4S,5R,6R)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoxy]oxane-3,4,5-triol |
SMILES (Canonical) | COC1=C(C=CC(=C1)C=CCOC2C(C(C(C(O2)COC3C(C(CO3)(CO)O)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C=CCO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO[C@H]3[C@@H]([C@](CO3)(CO)O)O)O)O)O)O |
InChI | InChI=1S/C21H30O12/c1-29-13-7-11(4-5-12(13)23)3-2-6-30-19-17(26)16(25)15(24)14(33-19)8-31-20-18(27)21(28,9-22)10-32-20/h2-5,7,14-20,22-28H,6,8-10H2,1H3/t14-,15-,16+,17-,18+,19-,20-,21-/m1/s1 |
InChI Key | KMVCKNBQSQYJHC-RHAOSNMYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H30O12 |
Molecular Weight | 474.50 g/mol |
Exact Mass | 474.17372639 g/mol |
Topological Polar Surface Area (TPSA) | 188.00 Ų |
XlogP | -2.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.78% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.24% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.21% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.09% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.97% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.67% | 89.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.49% | 95.93% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.81% | 89.62% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.64% | 92.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.88% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.41% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.51% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.26% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.83% | 99.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.48% | 91.49% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.10% | 90.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.01% | 97.36% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.84% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.20% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.47% | 94.73% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.46% | 95.83% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.10% | 91.03% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.83% | 92.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.65% | 94.00% |
CHEMBL3194 | P02766 | Transthyretin | 80.17% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Punica granatum |
PubChem | 162981461 |
LOTUS | LTS0167991 |
wikiData | Q105143217 |