3-Phenyl-4-propylpyridine
| Internal ID | 4de80c1d-5e0b-4d22-a10f-87356b7f54a5 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Phenylpyridines |
| IUPAC Name | 3-phenyl-4-propylpyridine |
| SMILES (Canonical) | CCCC1=C(C=NC=C1)C2=CC=CC=C2 |
| SMILES (Isomeric) | CCCC1=C(C=NC=C1)C2=CC=CC=C2 |
| InChI | InChI=1S/C14H15N/c1-2-6-12-9-10-15-11-14(12)13-7-4-3-5-8-13/h3-5,7-11H,2,6H2,1H3 |
| InChI Key | MDEOSZGDWLTQLL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.27 g/mol |
| Exact Mass | 197.120449483 g/mol |
| Topological Polar Surface Area (TPSA) | 12.90 Ų |
| XlogP | 3.80 |
| 53911-35-6 |
| EINECS 258-857-3 |
| Pyridine, 3-phenyl-4-propyl- |
| DTXSID70202190 |
| MDEOSZGDWLTQLL-UHFFFAOYSA-N |
| EN300-9264308 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.26% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.06% | 90.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.59% | 86.33% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 92.22% | 95.93% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.68% | 96.09% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.88% | 93.31% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 87.17% | 96.25% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 86.96% | 89.92% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.16% | 94.62% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.04% | 94.08% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 82.92% | 87.45% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.44% | 96.00% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.01% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Mentha × piperita |
| Mentha arvensis |
| PubChem | 104638 |
| LOTUS | LTS0099562 |
| wikiData | Q83075463 |