3'-O-Caffeoylsweroside
Internal ID | 44e65942-3495-42e7-b3b1-8e2d83b87b5d |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [(2S,3R,4S,5R,6R)-2-[[(3S,4R,4aS)-4-ethenyl-8-oxo-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl]oxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C=CC1C2CCOC(=O)C2=COC1OC3C(C(C(C(O3)CO)O)OC(=O)C=CC4=CC(=C(C=C4)O)O)O |
SMILES (Isomeric) | C=C[C@@H]1[C@@H]2CCOC(=O)C2=CO[C@H]1O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)OC(=O)/C=C/C4=CC(=C(C=C4)O)O)O |
InChI | InChI=1S/C25H28O12/c1-2-13-14-7-8-33-23(32)15(14)11-34-24(13)37-25-21(31)22(20(30)18(10-26)35-25)36-19(29)6-4-12-3-5-16(27)17(28)9-12/h2-6,9,11,13-14,18,20-22,24-28,30-31H,1,7-8,10H2/b6-4+/t13-,14+,18-,20-,21-,22+,24+,25+/m1/s1 |
InChI Key | XOGGREZGCFWEBP-KHYBMMPHSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C25H28O12 |
Molecular Weight | 520.50 g/mol |
Exact Mass | 520.15807632 g/mol |
Topological Polar Surface Area (TPSA) | 181.00 Ų |
XlogP | 1.00 |
[(2S,3R,4S,5R,6R)-2-[[(3S,4R,4aS)-4-ethenyl-8-oxo-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl]oxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.71% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.01% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.88% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.60% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.99% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.55% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.45% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.12% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.48% | 96.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.94% | 86.92% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.89% | 95.93% |
CHEMBL2581 | P07339 | Cathepsin D | 87.68% | 98.95% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.37% | 97.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.28% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.85% | 100.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.84% | 95.83% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.48% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 80.34% | 90.71% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.18% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lecocarpus lecocarpoides |
Neolamarckia cadamba |
PubChem | 10553980 |
LOTUS | LTS0067135 |
wikiData | Q105154672 |