3-O-Acetyloleanderolide
Internal ID | 24345dbb-52e0-4fcd-923c-66b8a4693ca9 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(1S,4S,5R,8R,10S,13R,14R,16S,17S,18R)-16-hydroxy-4,5,9,9,13,20,20-heptamethyl-23-oxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-10-yl] acetate |
SMILES (Canonical) | CC(=O)OC1CCC2(C(C1(C)C)CCC3(C2CC(C45C3(CCC6(C4CC(CC6)(C)C)C(=O)O5)C)O)C)C |
SMILES (Isomeric) | CC(=O)O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]3([C@@H]2C[C@@H]([C@@]45[C@]3(CC[C@@]6([C@H]4CC(CC6)(C)C)C(=O)O5)C)O)C)C |
InChI | InChI=1S/C32H50O5/c1-19(33)36-24-10-11-28(6)20(27(24,4)5)9-12-29(7)21(28)17-23(34)32-22-18-26(2,3)13-15-31(22,25(35)37-32)16-14-30(29,32)8/h20-24,34H,9-18H2,1-8H3/t20-,21+,22+,23-,24-,28-,29+,30-,31-,32+/m0/s1 |
InChI Key | SFSFDBPTPLSWRM-KXNUYETHSA-N |
Popularity | 2 references in papers |
Molecular Formula | C32H50O5 |
Molecular Weight | 514.70 g/mol |
Exact Mass | 514.36582469 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 7.00 |
62498-83-3 |
[(1S,4S,5R,8R,10S,13R,14R,16S,17S,18R)-16-hydroxy-4,5,9,9,13,20,20-heptamethyl-23-oxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-10-yl] acetate |
3beta-Acetoxy-12alpha-hydroxyoleanan-13beta,28-olide |
CHEMBL1914939 |
DTXSID201267015 |
AKOS032962377 |
FS-8898 |
3beta-Acetoxy-12-hydroxyoleanan-13,28-olide |
Oleanan-28-oic acid,3,12,13-trihydroxy-,-lactone,3-acetate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.91% | 94.45% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 94.81% | 82.69% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.77% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.73% | 96.09% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.67% | 96.38% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.11% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.70% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.72% | 91.19% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.56% | 91.07% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.05% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.58% | 99.23% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.19% | 97.14% |
CHEMBL2581 | P07339 | Cathepsin D | 84.03% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.45% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.14% | 92.62% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 82.04% | 95.38% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.65% | 93.04% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.64% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.20% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Betula ermanii |
Pieris japonica |
PubChem | 10929355 |
LOTUS | LTS0102616 |
wikiData | Q105252002 |