3-methoxy-2-methyl-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-1,9-diol
| Internal ID | bbe12177-231f-454b-8a30-5e038965e604 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Furanoisoflavonoids > Pterocarpans |
| IUPAC Name | 3-methoxy-2-methyl-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-1,9-diol |
| SMILES (Canonical) | CC1=C(C=C2C(=C1O)C3C(CO2)C4=C(O3)C=C(C=C4)O)OC |
| SMILES (Isomeric) | CC1=C(C=C2C(=C1O)C3C(CO2)C4=C(O3)C=C(C=C4)O)OC |
| InChI | InChI=1S/C17H16O5/c1-8-12(20-2)6-14-15(16(8)19)17-11(7-21-14)10-4-3-9(18)5-13(10)22-17/h3-6,11,17-19H,7H2,1-2H3 |
| InChI Key | MCVAANPKIGGVAL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 68.20 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of 3-methoxy-2-methyl-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-1,9-diol](https://plantaedb.com/storage/docs/compounds/2023/11/3-methoxy-2-methyl-6a11a-dihydro-6h-1benzofuro32-cchromene-19-diol.jpg "2D Structure of 3-methoxy-2-methyl-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-1,9-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.50% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.14% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.79% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.86% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.49% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.08% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.05% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.32% | 89.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.88% | 98.75% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.13% | 95.89% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.66% | 89.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.18% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.81% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.18% | 99.17% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.19% | 93.99% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.24% | 92.94% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.95% | 97.14% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.39% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Desmodium uncinatum |
| PubChem | 162905767 |
| LOTUS | LTS0150323 |
| wikiData | Q105161455 |