3-Methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-2-one
Internal ID | 8fb016de-de51-4b69-9f60-5ae0a1fe5d16 |
Taxonomy | Alkaloids and derivatives > Indolonaphthyridine alkaloids |
IUPAC Name | 3-methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-2-one |
SMILES (Canonical) | COC1CC2=NC=CC3=C2N(C1=O)C4=CC=CC=C34 |
SMILES (Isomeric) | COC1CC2=NC=CC3=C2N(C1=O)C4=CC=CC=C34 |
InChI | InChI=1S/C15H12N2O2/c1-19-13-8-11-14-10(6-7-16-11)9-4-2-3-5-12(9)17(14)15(13)18/h2-7,13H,8H2,1H3 |
InChI Key | KYKGSYAHKNQQER-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H12N2O2 |
Molecular Weight | 252.27 g/mol |
Exact Mass | 252.089877630 g/mol |
Topological Polar Surface Area (TPSA) | 44.10 Ų |
XlogP | 2.10 |
There are no found synonyms. |
![2D Structure of 3-Methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-2-one 2D Structure of 3-Methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/3-methoxy-16-diazatetracyclo761051601015hexadeca-57916101214-hexaen-2-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.50% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.29% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.01% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 95.11% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.10% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.58% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.77% | 99.23% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 89.63% | 96.47% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 86.96% | 96.39% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 86.75% | 92.67% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.91% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.48% | 94.00% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.52% | 96.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.99% | 91.11% |
CHEMBL2094121 | P14867 | GABA-A receptor; alpha-1/beta-3/gamma-2 | 81.50% | 95.50% |
CHEMBL2535 | P11166 | Glucose transporter | 80.44% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eurycoma longifolia |
PubChem | 73291749 |
LOTUS | LTS0276092 |
wikiData | Q105147749 |