3-Hydroxyflavone
Internal ID | 57f1af4f-9b2f-486e-b049-5dbc60f78276 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > Flavonols |
IUPAC Name | 3-hydroxy-2-phenylchromen-4-one |
SMILES (Canonical) | C1=CC=C(C=C1)C2=C(C(=O)C3=CC=CC=C3O2)O |
SMILES (Isomeric) | C1=CC=C(C=C1)C2=C(C(=O)C3=CC=CC=C3O2)O |
InChI | InChI=1S/C15H10O3/c16-13-11-8-4-5-9-12(11)18-15(14(13)17)10-6-2-1-3-7-10/h1-9,17H |
InChI Key | HVQAJTFOCKOKIN-UHFFFAOYSA-N |
Popularity | 12,935 references in papers |
Molecular Formula | C15H10O3 |
Molecular Weight | 238.24 g/mol |
Exact Mass | 238.062994177 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 3.40 |
Atomic LogP (AlogP) | 3.17 |
H-Bond Acceptor | 3 |
H-Bond Donor | 1 |
Rotatable Bonds | 1 |
Flavonol |
577-85-5 |
3-Hydroxy-2-phenyl-4H-chromen-4-one |
Flavon-3-ol |
3-Hydroxy-2-phenylchromone |
4H-1-Benzopyran-4-one, 3-hydroxy-2-phenyl- |
FLAVONE, 3-HYDROXY- |
3-hydroxy-2-phenylchromen-4-one |
3-HF |
FLAVONE,3-HYDROXY- |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9946 | 99.46% |
Caco-2 | + | 0.5000 | 50.00% |
Blood Brain Barrier | - | 0.8500 | 85.00% |
Human oral bioavailability | + | 0.8429 | 84.29% |
Subcellular localzation | Mitochondria | 0.8073 | 80.73% |
OATP2B1 inhibitior | - | 0.7266 | 72.66% |
OATP1B1 inhibitior | + | 0.9414 | 94.14% |
OATP1B3 inhibitior | + | 0.9640 | 96.40% |
MATE1 inhibitior | - | 0.7600 | 76.00% |
OCT2 inhibitior | - | 0.9750 | 97.50% |
BSEP inhibitior | - | 0.6102 | 61.02% |
P-glycoprotein inhibitior | - | 0.7436 | 74.36% |
P-glycoprotein substrate | - | 0.9270 | 92.70% |
CYP3A4 substrate | - | 0.5674 | 56.74% |
CYP2C9 substrate | - | 0.8209 | 82.09% |
CYP2D6 substrate | - | 0.8000 | 80.00% |
CYP3A4 inhibition | - | 0.8518 | 85.18% |
CYP2C9 inhibition | + | 0.7911 | 79.11% |
CYP2C19 inhibition | + | 0.7050 | 70.50% |
CYP2D6 inhibition | - | 0.9321 | 93.21% |
CYP1A2 inhibition | + | 0.9066 | 90.66% |
CYP2C8 inhibition | - | 0.6354 | 63.54% |
CYP inhibitory promiscuity | - | 0.5266 | 52.66% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 1.0000 | 100.00% |
Carcinogenicity (trinary) | Non-required | 0.5583 | 55.83% |
Eye corrosion | - | 0.9835 | 98.35% |
Eye irritation | + | 0.9171 | 91.71% |
Skin irritation | + | 0.7668 | 76.68% |
Skin corrosion | - | 0.9870 | 98.70% |
Ames mutagenesis | - | 0.6400 | 64.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.8615 | 86.15% |
Micronuclear | + | 0.8418 | 84.18% |
Hepatotoxicity | + | 0.6500 | 65.00% |
skin sensitisation | - | 0.7567 | 75.67% |
Respiratory toxicity | + | 0.7111 | 71.11% |
Reproductive toxicity | + | 0.8222 | 82.22% |
Mitochondrial toxicity | - | 0.5125 | 51.25% |
Nephrotoxicity | - | 0.6275 | 62.75% |
Acute Oral Toxicity (c) | II | 0.4611 | 46.11% |
Estrogen receptor binding | + | 0.8496 | 84.96% |
Androgen receptor binding | + | 0.6436 | 64.36% |
Thyroid receptor binding | + | 0.7565 | 75.65% |
Glucocorticoid receptor binding | + | 0.8891 | 88.91% |
Aromatase binding | + | 0.9192 | 91.92% |
PPAR gamma | + | 0.9183 | 91.83% |
Honey bee toxicity | - | 0.9416 | 94.16% |
Biodegradation | - | 0.7750 | 77.50% |
Crustacea aquatic toxicity | - | 0.5000 | 50.00% |
Fish aquatic toxicity | + | 0.8903 | 89.03% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1871 | P10275 | Androgen Receptor |
23500 nM |
IC50 |
PMID: 19592245
|
CHEMBL261 | P00915 | Carbonic anhydrase I |
5210 nM 5100 nM |
Ki Ki |
PMID: 22487176
PMID: 22487176 |
CHEMBL205 | P00918 | Carbonic anhydrase II |
9300 nM 9200 nM |
Ki Ki |
PMID: 22487176
PMID: 22487176 |
CHEMBL3594 | Q16790 | Carbonic anhydrase IX |
5540 nM 5630 nM |
Ki Ki |
PMID: 22487176
PMID: 22487176 |
CHEMBL3242 | O43570 | Carbonic anhydrase XII |
6590 nM 6650 nM |
Ki Ki |
PMID: 22487176
PMID: 22487176 |
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
12589.3 nM 15848.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4878 | Q16678 | Cytochrome P450 1B1 |
90 nM |
IC50 |
via Super-PRED
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
25118.9 nM 25118.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL4040 | P28482 | MAP kinase ERK2 |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
25118.9 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.96% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.07% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.87% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 92.70% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.51% | 89.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 88.07% | 94.23% |
CHEMBL262 | P49841 | Glycogen synthase kinase-3 beta | 87.01% | 95.72% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.36% | 94.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.21% | 95.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.68% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.54% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.66% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Acacia melanoxylon |
Chelidonium majus |
Chrysanthemum morifolium |
Cichorium intybus |
Cichorium pumilum |
Ginkgo biloba |
PubChem | 11349 |
NPASS | NPC93730 |
ChEMBL | CHEMBL294009 |
LOTUS | LTS0190891 |
wikiData | Q5919049 |