3-Hydroxy-2',5-dimethoxybiphenyl
| Internal ID | 9c363092-6218-4390-9caa-b72084507bf8 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenyls and derivatives |
| IUPAC Name | 3-methoxy-5-(2-methoxyphenyl)phenol |
| SMILES (Canonical) | COC1=CC=CC=C1C2=CC(=CC(=C2)OC)O |
| SMILES (Isomeric) | COC1=CC=CC=C1C2=CC(=CC(=C2)OC)O |
| InChI | InChI=1S/C14H14O3/c1-16-12-8-10(7-11(15)9-12)13-5-3-4-6-14(13)17-2/h3-9,15H,1-2H3 |
| InChI Key | DRLGTGZTVHFNOU-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.094294304 g/mol |
| Topological Polar Surface Area (TPSA) | 38.70 Ų |
| XlogP | 3.10 |
| 3-hydroxy-2',5-dimethoxybiphenyl |
| CHEMBL1269081 |
| DTXSID60678603 |
| 2',5-Dimethoxy[1,1'-biphenyl]-3-ol |
| 1248374-15-3 |
| Q27138964 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.88% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.52% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.86% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.06% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.94% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.97% | 86.33% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 90.10% | 96.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.29% | 82.69% |
| CHEMBL240 | Q12809 | HERG | 88.40% | 89.76% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.17% | 97.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.82% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.28% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.45% | 90.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.11% | 95.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.68% | 94.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.35% | 93.31% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.56% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Rhaphiolepis indica |
| PubChem | 49831390 |
| LOTUS | LTS0143192 |
| wikiData | Q27138964 |