3-Epi-Isocucurbitacin D
Internal ID | 0ed8120e-5e9b-4c79-83f4-427eb70ca79b |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | (3R,8S,9R,10R,13R,14S,16R,17R)-17-[(E,2R)-2,6-dihydroxy-6-methyl-3-oxohept-4-en-2-yl]-3,16-dihydroxy-4,4,9,13,14-pentamethyl-3,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-2,11-dione |
SMILES (Canonical) | CC1(C(C(=O)CC2C1=CCC3C2(C(=O)CC4(C3(CC(C4C(C)(C(=O)C=CC(C)(C)O)O)O)C)C)C)O)C |
SMILES (Isomeric) | C[C@@]12C[C@H]([C@@H]([C@]1(CC(=O)[C@@]3([C@H]2CC=C4[C@H]3CC(=O)[C@@H](C4(C)C)O)C)C)[C@](C)(C(=O)/C=C/C(C)(C)O)O)O |
InChI | InChI=1S/C30H44O7/c1-25(2,36)12-11-21(33)30(8,37)23-19(32)14-27(5)20-10-9-16-17(13-18(31)24(35)26(16,3)4)29(20,7)22(34)15-28(23,27)6/h9,11-12,17,19-20,23-24,32,35-37H,10,13-15H2,1-8H3/b12-11+/t17-,19-,20+,23+,24+,27+,28-,29+,30+/m1/s1 |
InChI Key | ALPSEMFPAVSKJO-WCGKEEAASA-N |
Popularity | 2 references in papers |
Molecular Formula | C30H44O7 |
Molecular Weight | 516.70 g/mol |
Exact Mass | 516.30870374 g/mol |
Topological Polar Surface Area (TPSA) | 132.00 Ų |
XlogP | 1.90 |
CHEMBL2022241 |
SCHEMBL10307338 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.76% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.29% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.41% | 97.25% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 91.23% | 97.05% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.80% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.88% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.54% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.20% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.55% | 85.14% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.65% | 89.34% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.50% | 91.07% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.85% | 90.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.94% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.53% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.57% | 90.17% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.56% | 94.75% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.43% | 96.95% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 80.39% | 98.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.00% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bryonia cretica |
Phormium tenax |
Physocarpus opulifolius |
PubChem | 57384018 |
LOTUS | LTS0135087 |
wikiData | Q104914278 |